ETV6::NTRK3 |
Fusion Gene Summary |
 Fusion Gene Summary |
| Fusion gene name: ETV6-NTRK3 | Hgene | Tgene | Gene symbol | ETV6 | NTRK3 | Gene ID | 2120 | 4916 |
| Gene name | ETS variant transcription factor 6 | neurotrophic receptor tyrosine kinase 3 |
| Synonyms | TEL|TEL/ABL|THC5|ETV6 | GP145-TrkC|TRKC|gp145(trkC)|NTRK3 |
| Cytomap | 12p13.2 | 15q25.3 |
| Type of gene | protein-coding | protein-coding |
| Description | transcription factor ETV6ETS-related protein Tel1ETV6-RUNX1 fusion proteinTEL1 oncogeneets variant gene 6 (TEL oncogene) | NT-3 growth factor receptorETS related protein-neurotrophic receptor tyrosine kinase fusion proteinETV6-NTRK3 fusionneurotrophic tyrosine kinase, receptor, type 3tyrosine kinase receptor C |
| Modification date | 20240305 | 20240411 |
| UniProtAcc | . | . |
| Gene ontology of each fusion partner gene with evidence of Inferred from Direct Assay (IDA) from Entrez |
| Partner | Gene | GO ID | GO term | PubMed ID |
| Hgene | ETV6 | GO:0000122 | negative regulation of transcription by RNA polymerase II | 10514502 |
| Tgene | NTRK3 | GO:0001933 | negative regulation of protein phosphorylation | 23027130 |
| Tgene | NTRK3 | GO:0007169 | cell surface receptor protein tyrosine kinase signaling pathway | 23027130 |
| Tgene | NTRK3 | GO:0008284 | positive regulation of cell population proliferation | 23027130 |
| Tgene | NTRK3 | GO:0010628 | positive regulation of gene expression | 23027130 |
| Tgene | NTRK3 | GO:0030335 | positive regulation of cell migration | 23027130 |
| Tgene | NTRK3 | GO:0032148 | activation of protein kinase B activity | 23027130 |
| Tgene | NTRK3 | GO:0033138 | positive regulation of peptidyl-serine phosphorylation | 23027130 |
| Tgene | NTRK3 | GO:0043406 | positive regulation of MAP kinase activity | 23027130 |
| Tgene | NTRK3 | GO:0050927 | positive regulation of positive chemotaxis | 23027130 |
| Tgene | NTRK3 | GO:0090630 | activation of GTPase activity | 23027130 |
Fusion Gene Expressed Sample Information |
| Fusion gene information from FusionGDB2.0 (ChiTars 5.0 and ChimerDB 4.0), COSMIC, and CCLE. |
| * All genome coordinats were lifted-over on hg19. * Click on the break point to see the gene structure around the break point region using the UCSC Genome Browser. |
| Source | Sample | Hgene | Hchr | Hbp | Tgene | Tchr | Tbp |
| ChimerDB4 | AF041811 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88419991 |
| ChimerDB4 | TCGA-AO-A03U-01B | ETV6 | chr12 | 12022902 | NTRK3 | chr15 | 88483983 |
| ChimerDB4 | TCGA-AO-A03U-01B | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| ChimerDB4 | TCGA-CE-A27D-01A | ETV6 | chr12 | 12006495 | NTRK3 | chr15 | 88576276 |
| ChiTaRS5.0 | AF041811 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483987 |
| COSMIC | 10 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1180677 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1180678 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1180679 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1180680 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1180681 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1180682 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1180683 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1180684 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1180685 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1180686 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1180963 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1180964 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1180965 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1180966 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1180967 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1180968 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1180969 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1183363 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1183364 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1183366 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1183367 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1183368 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1183369 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1183370 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1183371 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1183372 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1183373 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1183374 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1183375 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1183376 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1183426 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1183427 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1183428 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1183429 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1183430 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1183431 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1183432 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1183433 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1183434 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1183435 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1183436 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1183437 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1183443 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1183444 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1183445 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1198246 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1226448 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1226449 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1226450 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1226651 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1226652 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1226653 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1227070 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1227809 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1227810 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1227811 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1227812 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1227813 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1227817 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1227818 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1227819 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1227821 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1227822 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1227823 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1227824 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1227825 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1227826 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1227827 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1227828 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1227829 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1227830 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1227831 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1227832 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1227834 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1227835 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1227859 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1227860 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1227861 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1227862 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1301783 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1301784 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1301785 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1301786 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1301787 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1301788 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1301789 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1301790 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1301792 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1301793 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1333007 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1333008 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1346453 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1346454 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1346455 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1346456 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1346457 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1346458 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1346459 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1346461 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1346463 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1346464 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1346465 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1346466 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1346467 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1348080 | ETV6 | chr12 | 12006495 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1348365 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1348366 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1348367 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1348368 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 13 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 1745113 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 2068135 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 2068136 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 2068139 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 2068140 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 2068745 | ETV6 | chr12 | 12006495 | NTRK3 | chr15 | 88576276 |
| COSMIC | 2068746 | ETV6 | chr12 | 12006495 | NTRK3 | chr15 | 88576276 |
| COSMIC | 2068747 | ETV6 | chr12 | 12006495 | NTRK3 | chr15 | 88576276 |
| COSMIC | 2068748 | ETV6 | chr12 | 12006495 | NTRK3 | chr15 | 88576276 |
| COSMIC | 2068749 | ETV6 | chr12 | 12006495 | NTRK3 | chr15 | 88576276 |
| COSMIC | 2068750 | ETV6 | chr12 | 12006495 | NTRK3 | chr15 | 88576276 |
| COSMIC | 2068751 | ETV6 | chr12 | 12006495 | NTRK3 | chr15 | 88576276 |
| COSMIC | 2068752 | ETV6 | chr12 | 12006495 | NTRK3 | chr15 | 88576276 |
| COSMIC | 2068753 | ETV6 | chr12 | 12006495 | NTRK3 | chr15 | 88576276 |
| COSMIC | 2068807 | ETV6 | chr12 | 12006495 | NTRK3 | chr15 | 88576276 |
| COSMIC | 2068808 | ETV6 | chr12 | 12006495 | NTRK3 | chr15 | 88576276 |
| COSMIC | 2068809 | ETV6 | chr12 | 12006495 | NTRK3 | chr15 | 88576276 |
| COSMIC | 2068810 | ETV6 | chr12 | 12006495 | NTRK3 | chr15 | 88576276 |
| COSMIC | 2068811 | ETV6 | chr12 | 12006495 | NTRK3 | chr15 | 88576276 |
| COSMIC | 2068812 | ETV6 | chr12 | 12006495 | NTRK3 | chr15 | 88576276 |
| COSMIC | 2068813 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88576276 |
| COSMIC | 587226 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | 5 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| COSMIC | MCH-MN-1 | ETV6 | chr12 | 12022903 | NTRK3 | chr15 | 88483984 |
| # fusion gene expressed samples. |
| X-axis: resources, Y-axis: # samples |
Fusion Gene and Drug/Small Molecule Search from PubMed Abstracts |
| PubMed Abstract Search With ['A-B' AND 'drug'], ['A::B' AND 'drug']. *We used all combinations of gene synonyms of both partner genes and all combinations of ~ 14K drugs/small molecules in three categories of libraries (05-30-2024) |
| Statistics of the Found Drugs/Small Molecules. |
| PMID | Fusion Gene Name | Drug | Study Title |
| 29237803 | ETV6-TRKC | Entrectinib | Antitumor Activity of Entrectinib, a Pan-TRK, ROS1, and ALK Inhibitor, in ETV6-NTRK3-Positive Acute Myeloid Leukemia. |
| 21148487 | ETV6-NTRK3 | BMS-754807 | ETV6-NTRK3-mediated breast epithelial cell transformation is blocked by targeting the IGF1R signaling pathway. |
| 38699646 | ETV6-NTRK3 | Brigatinib | Rapid response to fifth-line brigatinib plus entrectinib in an ALK-rearranged lung adenocarcinoma with an acquired ETV6-NTRK3 fusion: a case report. |
| 34250401 | ETV6-NTRK3 | Cabozantinib | Response to Cabozantinib Following Acquired Entrectinib Resistance in a Patient With ETV6-NTRK3 Fusion-Positive Carcinoma Harboring the NTRK3 G623R Solvent-Front Mutation. |
| 33028644 | ETV6-NTRK3 | Cabozantinib | Infantile fibrosarcoma-like tumor driven by novel RBPMS-MET fusion consolidated with cabozantinib. |
| 28497708 | ETV6-NTRK3 | Carboplatin | Salivary Gland Secretory Carcinoma With High-Grade Transformation, CDKN2A/B Loss, Distant Metastasis, and Lack of Sustained Response to Crizotinib. |
| 23811600 | ETV6-NTRK3 | Crizotinib | Chaperones as thermodynamic sensors of drug-target interactions reveal kinase inhibitor specificities in living cells. |
| 33028644 | ETV6-NTRK3 | Cyclophosphamide | Infantile fibrosarcoma-like tumor driven by novel RBPMS-MET fusion consolidated with cabozantinib. |
| 34030125 | ETV6-NTRK3 | Entrectinib | Clinical Activity of Selitrectinib in a Patient With Mammary Analogue Secretory Carcinoma of the Parotid Gland With Secondary Resistance to Entrectinib. |
| 29568395 | ETV6-NTRK3 | Entrectinib | Merestinib (LY2801653) inhibits neurotrophic receptor kinase (NTRK) and suppresses growth of NTRK fusion bearing tumors. |
| 33738452 | ETV6-NTRK3 | Entrectinib | The experience of successful treatment of ETV6-NTRK3-positive infant glioblastoma with entrectinib. |
| 34250401 | ETV6-NTRK3 | Entrectinib | Response to Cabozantinib Following Acquired Entrectinib Resistance in a Patient With ETV6-NTRK3 Fusion-Positive Carcinoma Harboring the NTRK3 G623R Solvent-Front Mutation. |
| 38699646 | ETV6-NTRK3 | Entrectinib | Rapid response to fifth-line brigatinib plus entrectinib in an ALK-rearranged lung adenocarcinoma with an acquired ETV6-NTRK3 fusion: a case report. |
| 35735423 | ETV6-NTRK3 | Entrectinib | TRK Inhibition with Entrectinib in Metastatic Salivary Secretory Carcinoma (SC): A Case Report. |
| 37188179 | ETV6-NTRK3 | Entrectinib | Case Report: Identification of a novel NTRK3-AJUBA fusion co-existing with ETV6-NTRK3 fusion in papillary thyroid carcinoma. |
| 38357305 | ETV6-NTRK3 | Entrectinib | From genomic spectrum of NTRK genes to adverse effects of its inhibitors, a comprehensive genome-based and real-world pharmacovigilance analysis. |
| 37338765 | ETV6-NTRK3 | Entrectinib | Development of a Cell Line Containing the Chimeric ETV6-NTRK3 Gene. The Search for Mutations of the Tyrosine Kinase Chimeric Domain That Cause Resistance to Larotrectinib. |
| 36703785 | ETV6-NTRK3 | Entrectinib | Case report: Acquired neurotrophic tyrosine receptor kinase inhibitor resistance in a patient with pancreatic neuroendocrine carcinoma receiving entrectinib. |
| 34429303 | ETV6-NTRK3 | Entrectinib | Mechanisms of targeted therapy resistance in a pediatric glioma driven by ETV6-NTRK3 fusion. |
| 31965543 | ETV6-NTRK3 | Entrectinib | The Evolving Diagnostic and Treatment Landscape of NTRK-Fusion-Driven Pediatric Cancers. |
| 36743521 | ETV6-NTRK3 | Entrectinib | TRK inhibitor in a patient with metastatic triple-negative breast cancer and NTRK fusions identified via cell-free DNA analysis. |
| 34176200 | ETV6-NTRK3 | Entrectinib | Locally Recurrent Secretory Carcinoma of the Breast with NTRK3 Gene Fusion. |
| 38228123 | ETV6-NTRK3 | Gold | Efficacy of Fine-Needle Aspiration Cytology in Diagnosing Secretory Carcinoma of Salivary Gland: A Systematic Review and Meta-Analysis. |
| 29568395 | ETV6-NTRK3 | Larotrectinib | Merestinib (LY2801653) inhibits neurotrophic receptor kinase (NTRK) and suppresses growth of NTRK fusion bearing tumors. |
| 32923892 | ETV6-NTRK3 | Larotrectinib | Regression of ETV6-NTRK3 Infantile Glioblastoma After First-Line Treatment With Larotrectinib. |
| 37576877 | ETV6-NTRK3 | Larotrectinib | Larotrectinib treatment for infantile fibrosarcoma in newborns: a case report and literature review. |
| 33093355 | ETV6-NTRK3 | Larotrectinib | Adjuvant Maintenance Larotrectinib Therapy in 2 Children With NTRK Fusion-positive High-grade Cancers. |
| 35761904 | ETV6-NTRK3 | Larotrectinib | Larotrectinib as an Effective Therapy in Congenital Infantile Fibrosarcoma: Report of Two Cases. |
| 34036219 | ETV6-NTRK3 | Larotrectinib | NTRK Fusions Identified in Pediatric Tumors: The Frequency, Fusion Partners, and Clinical Outcome. |
| 36223973 | ETV6-NTRK3 | Larotrectinib | Metastatic triple negative breast cancer with NTRK gene fusion on tissue but not on ctDNA molecular profile. |
| 33622165 | ETV6-NTRK3 | Larotrectinib | Treatment of infantile fibrosarcoma associated to an abdominal aortic aneurysm with larotrectinib: a case report. |
| 37097530 | ETV6-NTRK3 | Larotrectinib | Therapeutic strategies and clinical evolution of patients with infantile fibrosarcoma: a unique paediatric case series. |
| 37188179 | ETV6-NTRK3 | Larotrectinib | Case Report: Identification of a novel NTRK3-AJUBA fusion co-existing with ETV6-NTRK3 fusion in papillary thyroid carcinoma. |
| 36186229 | ETV6-NTRK3 | Larotrectinib | A rapid and durable response to larotrectinib in a patient with NTRK fusion-positive secretory carcinoma originating from the external auditory canal. |
| 32223937 | ETV6-NTRK3 | Larotrectinib | Rapid, complete and sustained tumour response to the TRK inhibitor larotrectinib in an infant with recurrent, chemotherapy-refractory infantile fibrosarcoma carrying the characteristic ETV6-NTRK3 gene fusion. |
| 38357305 | ETV6-NTRK3 | Larotrectinib | From genomic spectrum of NTRK genes to adverse effects of its inhibitors, a comprehensive genome-based and real-world pharmacovigilance analysis. |
| 37338765 | ETV6-NTRK3 | Larotrectinib | Development of a Cell Line Containing the Chimeric ETV6-NTRK3 Gene. The Search for Mutations of the Tyrosine Kinase Chimeric Domain That Cause Resistance to Larotrectinib. |
| 32610377 | ETV6-NTRK3 | Larotrectinib | [Clinicopathological characteristics of NTRK-rearranged mesenchymal tumors in childhood]. |
| 29233640 | ETV6-NTRK3 | Larotrectinib | Rapid Response to Larotrectinib (LOXO-101) in an Adult Chemotherapy-Naive Patients With Advanced Triple-Negative Secretory Breast Cancer Expressing ETV6-NTRK3 Fusion. |
| 37036164 | ETV6-NTRK3 | Larotrectinib | Targeted therapy using larotrectinib and venetoclax for the relapsed/refractory T-cell acute lymphoblastic leukemia harboring a cryptic ETV6-NTRK3 fusion. |
| 30220707 | ETV6-NTRK3 | Larotrectinib | Brief Report: Potent clinical and radiological response to larotrectinib in TRK fusion-driven high-grade glioma. |
| 31738425 | ETV6-NTRK3 | Larotrectinib | Rapid, complete and sustained tumour response to the TRK inhibitor larotrectinib in an infant with recurrent, chemotherapy-refractory infantile fibrosarcoma carrying the characteristic ETV6-NTRK3 gene fusion. |
| 31965543 | ETV6-NTRK3 | Larotrectinib | The Evolving Diagnostic and Treatment Landscape of NTRK-Fusion-Driven Pediatric Cancers. |
| 36743521 | ETV6-NTRK3 | Larotrectinib | TRK inhibitor in a patient with metastatic triple-negative breast cancer and NTRK fusions identified via cell-free DNA analysis. |
| 34176200 | ETV6-NTRK3 | Larotrectinib | Locally Recurrent Secretory Carcinoma of the Breast with NTRK3 Gene Fusion. |
| 36610231 | ETV6-NTRK3 | Larotrectinib | Precision oncology using organoids of a secretory carcinoma of the salivary gland treated with TRK-inhibitors. |
| 38699646 | ETV6-NTRK3 | Lorlatinib | Rapid response to fifth-line brigatinib plus entrectinib in an ALK-rearranged lung adenocarcinoma with an acquired ETV6-NTRK3 fusion: a case report. |
| 29568395 | ETV6-NTRK3 | Merestinib | Merestinib (LY2801653) inhibits neurotrophic receptor kinase (NTRK) and suppresses growth of NTRK fusion bearing tumors. |
| 23131561 | ETV6-NTRK3 | Midostaurin | ETV6-NTRK3 as a therapeutic target of small molecule inhibitor PKC412. |
| 36378538 | ETV6-NTRK3 | Paclitaxel | Entrectinib in the neoadjuvant setting of anaplastic thyroid cancer: a case report. |
| 31965543 | ETV6-NTRK3 | Repotrectinib | The Evolving Diagnostic and Treatment Landscape of NTRK-Fusion-Driven Pediatric Cancers. |
| 37686522 | ETV6-NTRK3 | Selitrectinib | The Impact of ETV6-NTRK3 Oncogenic Gene Fusions on Molecular and Signaling Pathway Alterations. |
| 34030125 | ETV6-NTRK3 | Selitrectinib | Clinical Activity of Selitrectinib in a Patient With Mammary Analogue Secretory Carcinoma of the Parotid Gland With Secondary Resistance to Entrectinib. |
| 31965543 | ETV6-NTRK3 | Selitrectinib | The Evolving Diagnostic and Treatment Landscape of NTRK-Fusion-Driven Pediatric Cancers. |
| 34429303 | ETV6-NTRK3 | Selitrectinib | Mechanisms of targeted therapy resistance in a pediatric glioma driven by ETV6-NTRK3 fusion. |
| 30422774 | ETV6-NTRK3 | Somatostatin | Primary Lung Tumors in Children: Radiologic-Pathologic Correlation From the Radiologic Pathology Archives. |
| 38420532 | ETV6-NTRK3 | Tyrosine | Unraveling the spectrum of inflammatory myofibroblastic tumors in the lung: A comprehensive case series highlighting endobronchial, pleural, and lung parenchymal tumors. |
| 38699646 | ETV6-NTRK3 | Tyrosine | Rapid response to fifth-line brigatinib plus entrectinib in an ALK-rearranged lung adenocarcinoma with an acquired ETV6-NTRK3 fusion: a case report. |
| 37686522 | ETV6-NTRK3 | Tyrosine | The Impact of ETV6-NTRK3 Oncogenic Gene Fusions on Molecular and Signaling Pathway Alterations. |
| 38357305 | ETV6-NTRK3 | Tyrosine | From genomic spectrum of NTRK genes to adverse effects of its inhibitors, a comprehensive genome-based and real-world pharmacovigilance analysis. |
| 37142453 | ETV6-NTRK3 | Tyrosine | Elaboration of NTRK-rearranged colorectal cancer: Integration of immunoreactivity pattern, cytogenetic identity, and rearrangement variant. |
| 37036164 | ETV6-NTRK3 | Venetoclax | Targeted therapy using larotrectinib and venetoclax for the relapsed/refractory T-cell acute lymphoblastic leukemia harboring a cryptic ETV6-NTRK3 fusion. |
| 33028644 | ETV6-NTRK3 | Vincristine | Infantile fibrosarcoma-like tumor driven by novel RBPMS-MET fusion consolidated with cabozantinib. |
| 26849118 | ETV6-NTRK3 | Vincristine | Conservative strategy in infantile fibrosarcoma is possible: The European paediatric Soft tissue sarcoma Study Group experience. |
| Statistics of # PMIDs per found drug for this fusion gene. |
| X-axis: drugs, Y-axis: # PMIDs |
Fusion Gene and Diseases from the Found PubMed Abstracts |
| Diseases Related to This Fusion Gene from the Found PMID's MeSH terms |
| MeSH ID | MeSH Term |
| D001943 | Breast Neoplasms |
| D018572 | Disease-Free Survival; Soft Tissue Neoplasms |
| D012983 | Disease-Free Survival; Soft Tissue Neoplasms |
Fusion Gene and Diseases from Manual Curation and Other Resource |
| Diseases that have this fusion gene. (Manual curation of PubMed, 04-30-2022 + MyCancerGenome) |
| Hgene | Tgene | Disease | Source | PMID |
| ETV6 | NTRK3 | Pediatric Glioma | PubMed | 34429303 |
| ETV6 | NTRK3 | Mammary Analog Secretory Carcinoma Of Salivary Gland | MyCancerGenome | |
| ETV6 | NTRK3 | Fibrosarcoma | MyCancerGenome | |
| ETV6 | NTRK3 | Colon Adenocarcinoma | MyCancerGenome | |
| ETV6 | NTRK3 | Pancreatic Adenocarcinoma | MyCancerGenome | |
| ETV6 | NTRK3 | Thyroid Gland Papillary Carcinoma | MyCancerGenome |
| Diseases associated with fusion partners. (DisGeNet 4.0) |
| Partner | Gene | Disease ID | Disease name | # pubmeds | Source |
| Hgene | ETV6 | C4015537 | THROMBOCYTOPENIA 5 | 4 | CTD_human;GENOMICS_ENGLAND;UNIPROT |
| Hgene | ETV6 | C0023485 | Precursor B-Cell Lymphoblastic Leukemia-Lymphoma | 3 | CTD_human |
| Hgene | ETV6 | C0040034 | Thrombocytopenia | 3 | CTD_human;GENOMICS_ENGLAND |
| Hgene | ETV6 | C0023480 | Leukemia, Myelomonocytic, Chronic | 2 | ORPHANET |
| Hgene | ETV6 | C1332965 | Congenital Mesoblastic Nephroma | 2 | ORPHANET |
| Tgene | NTRK3 | C0036341 | Schizophrenia | 3 | PSYGENET |
| Tgene | NTRK3 | C0041696 | Unipolar Depression | 2 | PSYGENET |
| Tgene | NTRK3 | C1269683 | Major Depressive Disorder | 2 | PSYGENET |
| Tgene | NTRK3 | C1332965 | Congenital Mesoblastic Nephroma | 2 | ORPHANET |
Details of the Found Drugs/Small Molecules |
| Details of the Found Drugs/Small Molecules from DrugBank. |
| DrugBank ID | Generic Name | Drug Type | Drug Group | Structure | Weight | Chemical Formula | Synonyms | SMILES |
| DB11986 | Entrectinib | small molecule | "approved, investigational" |  | 560.65 | C31H34F2N6O2 | "Entrectinib, N-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]-4-(4-methylpiperazin-1-yl)-2-(oxan-4-ylamino)benzamide" | CN1CCN(CC1)C1=CC=C(C(=O)NC2=NNC3=CC=C(CC4=CC(F)=CC(F)=C4)C=C23)C(NC2CCOCC2)=C1 |
| DB12267 | Brigatinib | small molecule | "approved, investigational" |  | 584.1 | C29H39ClN7O2P | Brigatinib | COC1=CC(=CC=C1NC1=NC=C(Cl)C(NC2=CC=CC=C2P(C)(C)=O)=N1)N1CCC(CC1)N1CCN(C)CC1 |
| DB08875 | Cabozantinib | small molecule | "approved, investigational" |  | 501.514 | C28H24FN3O5 | Cabozantinib | COC1=CC2=C(C=C1OC)C(OC1=CC=C(NC(=O)C3(CC3)C(=O)NC3=CC=C(F)C=C3)C=C1)=CC=N2 |
| DB00958 | Carboplatin | small molecule | approved | 371.254 | C6H12N2O4Pt | "Carboplatin, Carboplatine, Carboplatino, CBDCA, cis-(1,1-cyclobutanedicarboxylato)diammineplatinum(II), cis-diammine(1,1-cyclobutanedicarboxylato)platinum, cis-diammine(1,1-cyclobutanedicarboxylato)platinum(II)" | [H][N]([H])([H])[Pt]1(OC(=O)C2(CCC2)C(=O)O1)[N]([H])([H])[H] | |
| DB08865 | Crizotinib | small molecule | "approved, investigational" |  | 450.337 | C21H22Cl2FN5O | "(R)-crizotinib, Crizotinib, Crizotinibum" | C[C@@H](OC1=CC(=CN=C1N)C1=CN(N=C1)C1CCNCC1)C1=C(Cl)C=CC(F)=C1Cl |
| DB00531 | Cyclophosphamide | small molecule | "approved, investigational" |  | 261.086 | C7H15Cl2N2O2P | "(+-)-Cyclophosphamide, (±)-2-(BIS(2-CHLOROETHYL)AMINO)TETRAHYDRO-2H-1,3,2-OXAZAPHOSPHORINE 2-OXIDE MONOHYDRATE, (RS)-Cyclophosphamide, 2-[Bis(2-chloroethylamino)]-tetrahydro-2H-1,3,2-oxazaphosphorine-2-oxide, Anhydrous cyclophosphamide, Bis(2-chloroethy | ClCCN(CCCl)P1(=O)NCCCO1 |
| DB14723 | Larotrectinib | small molecule | "approved, investigational" |  | 428.444 | C21H22F2N6O2 | Larotrectinib | O[C@H]1CCN(C1)C(=O)NC1=C2N=C(C=CN2N=C1)N1CCC[C@@H]1C1=C(F)C=CC(F)=C1 |
| DB12130 | Lorlatinib | small molecule | "approved, investigational" |  | 406.421 | C21H19FN6O2 | Lorlatinib | C[C@H]1OC2=C(N)N=CC(=C2)C2=C(C#N)N(C)N=C2CN(C)C(=O)C2=C1C=C(F)C=C2 |
| DB06595 | Midostaurin | small molecule | "approved, investigational" |  | 570.649 | C35H30N4O4 | "4'-N-benzoylstaurosporine, Midostaurin" | CO[C@@H]1[C@@H](C[C@H]2O[C@]1(C)N1C3=C(C=CC=C3)C3=C1C1=C(C4=C(C=CC=C4)N21)C1=C3CNC1=O)N(C)C(=O)C1=CC=CC=C1 |
| DB01229 | Paclitaxel | small molecule | "approved, vet_approved" |  | 853.9061 | C47H51NO14 | "5beta,20-Epoxy-1,2-alpha,4,7beta,10beta,13alpha-hexahydroxytax-11-en-9-one 4,10-diacetate 2-benzoate 13-ester with (2R,3S)-N-benzoyl-3-phenylisoserine, ABI-007 COMPONENT PACLITAXEL, BENZENEPROPANOIC ACID, .BETA.-(BENZOYLAMINO)-.ALPHA.-HYDROXY-, (2AR,4S,4 | [H][C@]12[C@H](OC(=O)C3=CC=CC=C3)[C@]3(O)C[C@H](OC(=O)[C@H](O)[C@@H](NC(=O)C4=CC=CC=C4)C4=CC=CC=C4)C(C)=C([C@@H](OC(C)=O)C(=O)[C@]1(C)[C@@H](O)C[C@H]1OC[C@@]21OC(C)=O)C3(C)C |
| DB16826 | Repotrectinib | small molecule | "approved, investigational" |  | 355.373 | C18H18FN5O2 | "(3R,6S,)-45-FLUORO-3,6-DIMETHYL-5-OXA-2,8-DIAZA-1(5,3)-PYRAZOLO(1,5-A)PYRIMIDINA-4(1,2)-BENZENANONAPHAN-9-ONE, (7S,13R)-11-Fluoro-7,13-Dimethyl-6,7,13,14-Tetrahydro-1,15-Ethenopyrazolo[4,3-F][1,4,8,10]Benzoxatriazacyclotridecin-4(5H)-One, 1,15-ETHENO-1H- | C[C@H]1CNC(=O)C2=C3N=C(N[C@H](C)C4=CC(F)=CC=C4O1)C=CN3N=C2 |
| DB09099 | Somatostatin | small molecule | "approved, investigational" |  | 1637.9 | C76H104N18O19S2 | "Somatostatin, Somatostatina, Somatostatine, Somatostatinum, Synthetic growth hormone release-inhibiting hormone, Synthetic somatostatin-14" | C[C@@H](O)[C@@H]1NC(=O)[C@H](CC2=CC=CC=C2)NC(=O)[C@@H](NC(=O)[C@H](CCCCN)NC(=O)[C@H](CC2=CNC3=C2C=CC=C3)NC(=O)[C@H](CC2=CC=CC=C2)NC(=O)[C@H](CC2=CC=CC=C2)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CSSC[C@H](NC(=O)[C@H](CO)NC1=O)C(O)=O)NC(=O)CNC(=O)[C@H](C)N)[C@@H](C)O |
| DB00765 | Metyrosine | small molecule | approved |  | 195.2151 | C10H13NO3 | "(-)-alpha-Methyl-L-tyrosine, (–)-α-methyl-L-tyrosine, (S)-alpha-Methyltyrosine, Methyltyrosine, Metirosin, Metirosina, Métirosine, Metirosine, Metirosinum, Metyrosine, α-methyl-L-p-tyrosine, α-methyl-p-tyrosine, α-methyl-para-tyrosine, α-MPT" | C[C@](N)(CC1=CC=C(O)C=C1)C(O)=O |
| DB11581 | Venetoclax | small molecule | "approved, investigational" |  | 868.45 | C45H50ClN7O7S | "4-(4-((2-(4-chlorophenyl)-4,4-dimethylcyclohex-1-en-1-yl)methyl)piperazin-1-yl)-N-((3-nitro-4-((tetrahydro-2H-pyran-4-ylmethyl)amino)phenyl)sulfonyl)-2-(1H-pyrrolo(2,3-b)pyridin-5-yloxy)benzamide, 4-(4-{[2-(4-chlorophenyl)-4,4-dimethylcyclohex-1-en-1-yl] | CC1(C)CCC(CN2CCN(CC2)C2=CC=C(C(=O)NS(=O)(=O)C3=CC=C(NCC4CCOCC4)C(=C3)[N+]([O-])=O)C(OC3=CN=C4NC=CC4=C3)=C2)=C(C1)C1=CC=C(Cl)C=C1 |
| DB00541 | Vincristine | small molecule | "approved, investigational" |  | 824.972 | C46H56N4O10 | "22-Oxovincaleukoblastin, 22-Oxovincaleukoblastine, Leurocristine, Vincristin, Vincristina, Vincristine, Vincristinum" | [H][C@@]12N3CC[C@@]11C4=C(C=C(OC)C(=C4)[C@]4(C[C@H]5C[N@](C[C@](O)(CC)C5)CCC5=C4NC4=CC=CC=C54)C(=O)OC)N(C=O)[C@@]1([H])[C@](O)([C@H](OC(C)=O)[C@]2(CC)C=CC3)C(=O)OC |
| ADME (absorption, distribution, metabolism, and excretion) Properties of the Found Drugs/Small Molecules Using the Qikprop of Schrödinger. |
| Molecule | # stars | # amines | # amidines | # acids | # amides | # rotors | # rtvFG | CNS | mol_MW | dipole | SASA | FOSA | FISA | PISA | WPSA | volume | donorHB | accptHB | dip^2/V | ACxDN^.5/SA | glob | QPpolrz | QPlogPC16 | QPlogPoct | QPlogPw | QPlogPo/w | QPlogS | CIQPlogS | QPlogHERG | QPPCaco | QPlogBB | QPPMDCK | QPlogKp | IP(eV) | EA(eV) | # metab | QPlogKhsa | Human Oral Absorption | Percent Human Oral Absorption | SAfluorine | SAamideO | PSA | # NandO | Rule Of Five | # ringatoms | # in 34 | # in 56 | # noncon | # nonHatm | Rule Of Three | Jm | Spermine |
| Entrectinib | 1 | 1 | 0 | 0 | 0 | 6 | 0 | 1 | 560.645 | 4.959 | 918.941 | 435.368 | 108.96 | 280.83 | 93.783 | 1702.611 | 2 | 8.2 | 0.0144407 | 0.0126195 | 0.7503916 | 60.814 | 16.99 | 28.185 | 14.298 | 5.775 | -8.008 | -7.618 | -7.636 | 228.841 | -0.46 | 362.83 | -4.025 | 8.177 | 0.525 | 5 | 1.29 | 1 | 77.074 | 93.783 | 0 | 93.206 | 8 | 2 | 33 | 0 | 33 | 9 | 41 | 1 | 0 | |
| BMS-754807 | 1 | 0 | 0 | 0 | 0 | 4 | 1 | -1 | 461.501 | 12.288 | 781.919 | 327.153 | 101.372 | 304.804 | 48.59 | 1411.327 | 3 | 7.5 | 0.1069807 | 0.0166135 | 0.7781954 | 50.67 | 14.703 | 26.874 | 15.28 | 4.528 | -7.124 | -6.512 | -6.575 | 1082.901 | -0.674 | 995.208 | -1.93 | 8.315 | 0.755 | 1 | 0.705 | 1 | 100 | 48.59 | 0 | 103.237 | 10 | 0 | 28 | 3 | 25 | 7 | 34 | 1 | 0 | |
| Brigatinib | 3 | 2 | 0 | 0 | 0 | 6 | 0 | 1 | 584.1 | 5.238 | 961.607 | 565.227 | 67.713 | 277.28 | 51.387 | 1788.438 | 1 | 12.75 | 0.0153438 | 0.0132591 | 0.7409974 | 64.215 | 18.313 | 29.943 | 17.098 | 4.04 | -5.496 | -5.012 | -8.498 | 140.467 | 0.303 | 138.751 | -5.34 | 7.779 | 0.313 | 5 | 0.535 | 3 | 76.079 | 0 | 0 | 80.704 | 9 | 1 | 30 | 0 | 30 | 9 | 40 | 0 | 0 | |
| Cabozantinib | 1 | 0 | 0 | 0 | 0 | 8 | 1 | -1 | 501.513 | 2.408 | 848.446 | 298.718 | 83.964 | 418.954 | 46.81 | 1520.565 | 0 | 6 | 0.0038122 | 0 | 0.7537218 | 53.563 | 15.914 | 21.162 | 9.344 | 6.381 | -8.055 | -8.065 | -7.515 | 1583.695 | -0.789 | 1467.559 | -0.823 | 8.862 | 1.087 | 3 | 1.088 | 1 | 95.661 | 46.81 | 0 | 98.602 | 8 | 2 | 25 | 3 | 22 | 3 | 37 | 1 | 0.001 | |
| Crizotinib | 1 | 1 | 0 | 0 | 0 | 4 | 0 | 0 | 450.342 | 1.836 | 705.819 | 276.242 | 115.308 | 196.547 | 117.722 | 1279.647 | 3 | 5.25 | 0.002635 | 0.0128833 | 0.8076044 | 44.366 | 13.291 | 22.352 | 12.263 | 4.113 | -5.569 | -6.085 | -6.309 | 199.22 | -0.169 | 422.446 | -4.631 | 7.898 | 0.573 | 5 | 0.763 | 3 | 92.18 | 40.557 | 0 | 73.496 | 6 | 0 | 23 | 0 | 23 | 5 | 30 | 0 | 0 | |
| Cyclophosphamide | 0 | 0 | 0 | 0 | 0 | 3 | 1 | 0 | 261.087 | 5.135 | 426.973 | 218.784 | 62.254 | 0 | 145.935 | 736.587 | 1 | 8.5 | 0.0357987 | 0.0199076 | 0.9238054 | 21.398 | 7.074 | 13.416 | 10.396 | 0.67 | -1.594 | -1.368 | -2.765 | 2544.163 | 0.254 | 8553.179 | -2.379 | 9.604 | 0.112 | 1 | -0.966 | 3 | 91.823 | 0 | 0 | 41.431 | 4 | 0 | 6 | 0 | 6 | 4 | 14 | 0 | 27.806 | |
| Larotrectinib | 1 | 0 | 0 | 0 | 1 | 2 | 0 | 0 | 428.441 | 3.951 | 704.941 | 296.811 | 106.313 | 221.222 | 80.595 | 1265.401 | 2 | 6.2 | 0.0123374 | 0.0124381 | 0.8025972 | 45.316 | 12.248 | 21.728 | 13.356 | 3.688 | -6.308 | -5.725 | -4.407 | 742.268 | -0.46 | 1326.136 | -2.508 | 7.694 | 0.647 | 4 | 0.396 | 1 | 100 | 80.595 | 14.72 | 88.035 | 8 | 0 | 25 | 0 | 25 | 8 | 31 | 1 | 0.001 | |
| Lorlatinib | 0 | 0 | 0 | 0 | 0 | 2 | 0 | -2 | 406.418 | 3.336 | 628.512 | 252.012 | 177.909 | 151.734 | 46.857 | 1166.832 | 2 | 7.75 | 0.0095375 | 0.0174383 | 0.8528193 | 40.707 | 11.548 | 21.155 | 13.612 | 2.432 | -5.888 | -6.248 | -4.637 | 203.607 | -1.073 | 159.926 | -4.072 | 8.301 | 0.708 | 4 | 0.234 | 3 | 82.509 | 46.857 | 0 | 110.044 | 8 | 0 | 22 | 0 | 17 | 2 | 30 | 1 | 0 | |
| Merestinib | 3 | 0 | 0 | 0 | 0 | 4 | 0 | -2 | 552.539 | 11.944 | 888.183 | 152.232 | 174.417 | 475.161 | 86.373 | 1608.918 | 1 | 7.5 | 0.088661 | 0.0084442 | 0.7476273 | 60.204 | 17.805 | 27.778 | 14.275 | 5.893 | -9.289 | -9.373 | -7.882 | 219.735 | -1.546 | 285.872 | -2.676 | 8.519 | 1.051 | 1 | 1.294 | 1 | 77.447 | 86.373 | 0 | 115.66 | 9 | 2 | 32 | 0 | 32 | 0 | 41 | 1 | 0 | |
| Midostaurin | 1 | 0 | 0 | 0 | 0 | 3 | 0 | -1 | 570.646 | 4.282 | 702.83 | 258.64 | 76.95 | 367.239 | 0 | 1469.779 | 1 | 7.95 | 0.0124732 | 0.0113114 | 0.8895069 | 54.247 | 15.057 | 24.457 | 13.066 | 5.112 | -5.614 | -9.349 | -5.071 | 1845.775 | -0.266 | 959.529 | -1.356 | 7.849 | 0.594 | 3 | 0.937 | 3 | 89.417 | 0 | 0 | 74.994 | 8 | 2 | 35 | 0 | 35 | 6 | 43 | 0 | 0.061 | |
| Paclitaxel | 9 | 0 | 0 | 0 | 0 | 13 | 4 | -2 | 853.918 | 3.085 | 1106.647 | 390.621 | 215.373 | 500.653 | 0 | 2349.483 | 3 | 17.65 | 0.0040507 | 0.0276246 | 0.7723323 | 84.306 | 25.334 | 43.472 | 26.164 | 5.449 | -7.387 | -10.117 | -7.604 | 89.85 | -2.627 | 36.579 | -2.477 | 9.611 | 0.808 | 8 | 0.809 | 1 | 54.939 | 0 | 0 | 236.456 | 15 | 3 | 35 | 4 | 28 | 13 | 62 | 2 | 0 | |
| Repotrectinib | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 355.371 | 7.289 | 571.081 | 195.726 | 98.726 | 229.813 | 46.815 | 1034.405 | 2 | 5.75 | 0.0513649 | 0.0142392 | 0.8661532 | 37.438 | 10.349 | 19.304 | 11.938 | 3.04 | -4.853 | -4.807 | -4.794 | 1147.304 | -0.199 | 1035.881 | -2.529 | 8.611 | 0.994 | 2 | 0.331 | 3 | 100 | 46.815 | 0 | 78.99 | 7 | 0 | 22 | 0 | 15 | 3 | 26 | 0 | 0.015 | |
| Selitrectinib | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 380.424 | 12.968 | 606.671 | 281.234 | 80.081 | 198.097 | 47.259 | 1116.16 | 1 | 6 | 0.1506679 | 0.00989 | 0.8577542 | 40.407 | 10.5 | 20.243 | 10.463 | 3.652 | -5.365 | -5.295 | -4.778 | 1723.812 | -0.046 | 1617.533 | -2.298 | 8.656 | 1.156 | 4 | 0.497 | 3 | 100 | 47.259 | 0 | 69.099 | 7 | 0 | 25 | 0 | 20 | 7 | 28 | 0 | 0.008 | |
| Tyrosine | 0 | 1 | 0 | 1 | 0 | 5 | 0 | -1 | 181.191 | 3.643 | 392.324 | 48.949 | 197.573 | 145.802 | 0 | 627.352 | 4 | 3.75 | 0.0211499 | 0.0191168 | 0.9033592 | 17.135 | 7.418 | 13.573 | 11.448 | -1.872 | -0.624 | -0.684 | -2.71 | 8.372 | -0.953 | 3.958 | -6.23 | 8.873 | -0.359 | 5 | -0.847 | 2 | 32.502 | 0 | 0 | 96.476 | 4 | 0 | 6 | 0 | 6 | 0 | 13 | 1 | 0.025 | |
| Venetoclax | 11 | 1 | 0 | 0 | 0 | 11 | 0 | -2 | 868.446 | 7.734 | 1181.536 | 549.867 | 215.717 | 371.578 | 44.373 | 2422.563 | 3 | 13.2 | 0.0246915 | 0.0193503 | 0.7383035 | 87.282 | 25.958 | 42.26 | 21.542 | 7.215 | -9.608 | -12.228 | -8.265 | 22.241 | -2.23 | 15.66 | -5.193 | 8.516 | 1.081 | 9 | 1.938 | 1 | 54.425 | 0 | 0 | 175.599 | 14 | 3 | 45 | 0 | 45 | 13 | 61 | 3 | 0 | |
| Vincristine | 6 | 2 | 0 | 0 | 0 | 8 | 1 | -2 | 824.969 | 6.485 | 1046.149 | 646.754 | 197.772 | 201.624 | 0 | 2246.809 | 2 | 14.25 | 0.0187184 | 0.0192635 | 0.7930164 | 80.552 | 21.753 | 38.743 | 20.154 | 5.082 | -5.961 | -8.946 | -7.295 | 8.208 | -1.218 | 3.37 | -7.811 | 8.062 | 0.46 | 5 | 1.455 | 2 | 34.187 | 0 | 0 | 177.064 | 14 | 3 | 38 | 0 | 34 | 18 | 60 | 2 | 0 |
Clinical Trials of the Found Drugs/Small Molecules |
| Clinical Trials from clinicaltrials.gov (06-17-2024) |
| Fusion Gene Other terms in clinicaltrials.gov | Samll molecule Intervention in clinicaltrials.gov | NCT ID | Study Status | Phases | Disease | # Enrolment | Date |
| NTRK3 fusion | Crizotinib | NCT02465060 | ACTIVE_NOT_RECRUITING | PHASE2 | Advanced Lymphoma, Advanced Malignant Solid Neoplasm, Bladder Carcinoma, Breast Carcinoma, Cervical Carcinoma, Colon Carcinoma, Colorectal Carcinoma, Endometrial Carcinoma, Esophageal Carcinoma, Exocrine Pancreas Carcinoma, Gastric Carcinoma, Glioma, Head and Neck Carcinoma, Hematopoietic and Lymphoid Cell Neoplasm, Kidney Carcinoma, Liver Carcinoma, Lung Carcinoma, Lymphoma, Malignant Uterine Corpus Neoplasm, Malignant Uterine Neoplasm, Melanoma, Multiple Myeloma, Ovarian Carcinoma, Prostate Carcinoma, Rectal Carcinoma, Recurrent Bladder Carcinoma, Recurrent Breast Carcinoma, Recurrent Cervical Carcinoma, Recurrent Colon Carcinoma, Recurrent Colorectal Carcinoma, Recurrent Esophageal Carcinoma, Recurrent Gastric Carcinoma, Recurrent Glioma, Recurrent Head and Neck Carcinoma, Recurrent Liver Carcinoma, Recurrent Lung Carcinoma, Recurrent Lymphoma, Recurrent Malignant Solid Neoplasm, Recurrent Malignant Uterine Corpus Neoplasm, Recurrent Melanoma, Recurrent Multiple Myeloma, Recurrent Ovarian Carcinoma, Recurrent Pancreatic Carcinoma, Recurrent Prostate Carcinoma, Recurrent Rectal Carcinoma, Recurrent Skin Carcinoma, Recurrent Thyroid Gland Carcinoma, Refractory Lymphoma, Refractory Malignant Solid Neoplasm, Refractory Multiple Myeloma, Skin Carcinoma, Thyroid Gland Carcinoma | 6452 | 2015-08-17 |
| NTRK3 fusion | Crizotinib | NCT02568267 | ACTIVE_NOT_RECRUITING | PHASE2 | Breast Cancer, Cholangiocarcinoma, Colorectal Cancer, Head and Neck Neoplasms, Lymphoma, Large-Cell, Anaplastic, Melanoma, Neuroendocrine Tumors, Non-Small Cell Lung Cancer, Ovarian Cancer, Pancreatic Cancer, Papillary Thyroid Cancer, Primary Brain Tumors, Renal Cell Carcinoma, Sarcomas, Salivary Gland Cancers, Adult Solid Tumor | 534 | 2015-11-19 |
| NTRK3 fusion | Entrectinib | NCT02568267 | ACTIVE_NOT_RECRUITING | PHASE2 | Breast Cancer, Cholangiocarcinoma, Colorectal Cancer, Head and Neck Neoplasms, Lymphoma, Large-Cell, Anaplastic, Melanoma, Neuroendocrine Tumors, Non-Small Cell Lung Cancer, Ovarian Cancer, Pancreatic Cancer, Papillary Thyroid Cancer, Primary Brain Tumors, Renal Cell Carcinoma, Sarcomas, Salivary Gland Cancers, Adult Solid Tumor | 534 | 2015-11-19 |
| NTRK3 fusion | Entrectinib | NCT02650401 | ACTIVE_NOT_RECRUITING | PHASE1, PHASE2 | Solid Tumors, CNS Tumors | 69 | 2016-05-03 |
| NTRK3 fusion | Entrectinib | NCT03375437 | ACTIVE_NOT_RECRUITING | NA | Soft Tissue Sarcoma, Advanced Cancer, Metastatic Cancer | 376 | 2018-02-15 |
| NTRK3 fusion | Iodine | NCT04970134 | ACTIVE_NOT_RECRUITING | Unknown | Differentiated Thyroid Carcinoma, Medullary Thyroid Carcinoma | 150 | 2021-06-14 |
| NTRK3 fusion | Larotrectinib | NCT02465060 | ACTIVE_NOT_RECRUITING | PHASE2 | Advanced Lymphoma, Advanced Malignant Solid Neoplasm, Bladder Carcinoma, Breast Carcinoma, Cervical Carcinoma, Colon Carcinoma, Colorectal Carcinoma, Endometrial Carcinoma, Esophageal Carcinoma, Exocrine Pancreas Carcinoma, Gastric Carcinoma, Glioma, Head and Neck Carcinoma, Hematopoietic and Lymphoid Cell Neoplasm, Kidney Carcinoma, Liver Carcinoma, Lung Carcinoma, Lymphoma, Malignant Uterine Corpus Neoplasm, Malignant Uterine Neoplasm, Melanoma, Multiple Myeloma, Ovarian Carcinoma, Prostate Carcinoma, Rectal Carcinoma, Recurrent Bladder Carcinoma, Recurrent Breast Carcinoma, Recurrent Cervical Carcinoma, Recurrent Colon Carcinoma, Recurrent Colorectal Carcinoma, Recurrent Esophageal Carcinoma, Recurrent Gastric Carcinoma, Recurrent Glioma, Recurrent Head and Neck Carcinoma, Recurrent Liver Carcinoma, Recurrent Lung Carcinoma, Recurrent Lymphoma, Recurrent Malignant Solid Neoplasm, Recurrent Malignant Uterine Corpus Neoplasm, Recurrent Melanoma, Recurrent Multiple Myeloma, Recurrent Ovarian Carcinoma, Recurrent Pancreatic Carcinoma, Recurrent Prostate Carcinoma, Recurrent Rectal Carcinoma, Recurrent Skin Carcinoma, Recurrent Thyroid Gland Carcinoma, Refractory Lymphoma, Refractory Malignant Solid Neoplasm, Refractory Multiple Myeloma, Skin Carcinoma, Thyroid Gland Carcinoma | 6452 | 2015-08-17 |
| NTRK3 fusion | Larotrectinib | NCT02576431 | ACTIVE_NOT_RECRUITING | PHASE2 | Solid Tumors Harboring NTRK Fusion | 215 | 2015-09-30 |
| NTRK3 fusion | Larotrectinib | NCT02637687 | ACTIVE_NOT_RECRUITING | PHASE1, PHASE2 | Solid Tumors Harboring NTRK Fusion | 154 | 2015-12-16 |
| NTRK3 fusion | Larotrectinib | NCT03155620 | ACTIVE_NOT_RECRUITING | PHASE2 | Advanced Malignant Solid Neoplasm, Ann Arbor Stage III Non-Hodgkin Lymphoma, Ann Arbor Stage IV Non-Hodgkin Lymphoma, Histiocytic Sarcoma, Juvenile Xanthogranuloma, Langerhans Cell Histiocytosis, Malignant Glioma, Recurrent Childhood Rhabdomyosarcoma, Recurrent Ependymoma, Recurrent Ewing Sarcoma, Recurrent Glioma, Recurrent Hepatoblastoma, Recurrent Langerhans Cell Histiocytosis, Recurrent Malignant Germ Cell Tumor, Recurrent Malignant Solid Neoplasm, Recurrent Medulloblastoma, Recurrent Neuroblastoma, Recurrent Non-Hodgkin Lymphoma, Recurrent Osteosarcoma, Recurrent Peripheral Primitive Neuroectodermal Tumor, Recurrent Primary Central Nervous System Neoplasm, Recurrent Rhabdoid Tumor, Recurrent Soft Tissue Sarcoma, Refractory Ewing Sarcoma, Refractory Glioma, Refractory Hepatoblastoma, Refractory Langerhans Cell Histiocytosis, Refractory Malignant Germ Cell Tumor, Refractory Malignant Solid Neoplasm, Refractory Medulloblastoma, Refractory Neuroblastoma, Refractory Non-Hodgkin Lymphoma, Refractory Osteosarcoma, Refractory Peripheral Primitive Neuroectodermal Tumor, Refractory Primary Central Nervous System Neoplasm, Refractory Rhabdoid Tumor, Refractory Rhabdomyosarcoma, Rhabdoid Tumor, Stage III Osteosarcoma AJCC v7, Stage III Soft Tissue Sarcoma AJCC v7, Stage IV Osteosarcoma AJCC v7, Stage IV Soft Tissue Sarcoma AJCC v7, Stage IVA Osteosarcoma AJCC v7, Stage IVB Osteosarcoma AJCC v7, Wilms Tumor | 2316 | 2017-07-31 |
| NTRK3 fusion | MCC | NCT02465060 | ACTIVE_NOT_RECRUITING | PHASE2 | Advanced Lymphoma, Advanced Malignant Solid Neoplasm, Bladder Carcinoma, Breast Carcinoma, Cervical Carcinoma, Colon Carcinoma, Colorectal Carcinoma, Endometrial Carcinoma, Esophageal Carcinoma, Exocrine Pancreas Carcinoma, Gastric Carcinoma, Glioma, Head and Neck Carcinoma, Hematopoietic and Lymphoid Cell Neoplasm, Kidney Carcinoma, Liver Carcinoma, Lung Carcinoma, Lymphoma, Malignant Uterine Corpus Neoplasm, Malignant Uterine Neoplasm, Melanoma, Multiple Myeloma, Ovarian Carcinoma, Prostate Carcinoma, Rectal Carcinoma, Recurrent Bladder Carcinoma, Recurrent Breast Carcinoma, Recurrent Cervical Carcinoma, Recurrent Colon Carcinoma, Recurrent Colorectal Carcinoma, Recurrent Esophageal Carcinoma, Recurrent Gastric Carcinoma, Recurrent Glioma, Recurrent Head and Neck Carcinoma, Recurrent Liver Carcinoma, Recurrent Lung Carcinoma, Recurrent Lymphoma, Recurrent Malignant Solid Neoplasm, Recurrent Malignant Uterine Corpus Neoplasm, Recurrent Melanoma, Recurrent Multiple Myeloma, Recurrent Ovarian Carcinoma, Recurrent Pancreatic Carcinoma, Recurrent Prostate Carcinoma, Recurrent Rectal Carcinoma, Recurrent Skin Carcinoma, Recurrent Thyroid Gland Carcinoma, Refractory Lymphoma, Refractory Malignant Solid Neoplasm, Refractory Multiple Myeloma, Skin Carcinoma, Thyroid Gland Carcinoma | 6452 | 2015-08-17 |
| NTRK3 fusion | Ribose | NCT03155620 | ACTIVE_NOT_RECRUITING | PHASE2 | Advanced Malignant Solid Neoplasm, Ann Arbor Stage III Non-Hodgkin Lymphoma, Ann Arbor Stage IV Non-Hodgkin Lymphoma, Histiocytic Sarcoma, Juvenile Xanthogranuloma, Langerhans Cell Histiocytosis, Malignant Glioma, Recurrent Childhood Rhabdomyosarcoma, Recurrent Ependymoma, Recurrent Ewing Sarcoma, Recurrent Glioma, Recurrent Hepatoblastoma, Recurrent Langerhans Cell Histiocytosis, Recurrent Malignant Germ Cell Tumor, Recurrent Malignant Solid Neoplasm, Recurrent Medulloblastoma, Recurrent Neuroblastoma, Recurrent Non-Hodgkin Lymphoma, Recurrent Osteosarcoma, Recurrent Peripheral Primitive Neuroectodermal Tumor, Recurrent Primary Central Nervous System Neoplasm, Recurrent Rhabdoid Tumor, Recurrent Soft Tissue Sarcoma, Refractory Ewing Sarcoma, Refractory Glioma, Refractory Hepatoblastoma, Refractory Langerhans Cell Histiocytosis, Refractory Malignant Germ Cell Tumor, Refractory Malignant Solid Neoplasm, Refractory Medulloblastoma, Refractory Neuroblastoma, Refractory Non-Hodgkin Lymphoma, Refractory Osteosarcoma, Refractory Peripheral Primitive Neuroectodermal Tumor, Refractory Primary Central Nervous System Neoplasm, Refractory Rhabdoid Tumor, Refractory Rhabdomyosarcoma, Rhabdoid Tumor, Stage III Osteosarcoma AJCC v7, Stage III Soft Tissue Sarcoma AJCC v7, Stage IV Osteosarcoma AJCC v7, Stage IV Soft Tissue Sarcoma AJCC v7, Stage IVA Osteosarcoma AJCC v7, Stage IVB Osteosarcoma AJCC v7, Wilms Tumor | 2316 | 2017-07-31 |
| NTRK3 fusion | Selpercatinib | NCT03155620 | ACTIVE_NOT_RECRUITING | PHASE2 | Advanced Malignant Solid Neoplasm, Ann Arbor Stage III Non-Hodgkin Lymphoma, Ann Arbor Stage IV Non-Hodgkin Lymphoma, Histiocytic Sarcoma, Juvenile Xanthogranuloma, Langerhans Cell Histiocytosis, Malignant Glioma, Recurrent Childhood Rhabdomyosarcoma, Recurrent Ependymoma, Recurrent Ewing Sarcoma, Recurrent Glioma, Recurrent Hepatoblastoma, Recurrent Langerhans Cell Histiocytosis, Recurrent Malignant Germ Cell Tumor, Recurrent Malignant Solid Neoplasm, Recurrent Medulloblastoma, Recurrent Neuroblastoma, Recurrent Non-Hodgkin Lymphoma, Recurrent Osteosarcoma, Recurrent Peripheral Primitive Neuroectodermal Tumor, Recurrent Primary Central Nervous System Neoplasm, Recurrent Rhabdoid Tumor, Recurrent Soft Tissue Sarcoma, Refractory Ewing Sarcoma, Refractory Glioma, Refractory Hepatoblastoma, Refractory Langerhans Cell Histiocytosis, Refractory Malignant Germ Cell Tumor, Refractory Malignant Solid Neoplasm, Refractory Medulloblastoma, Refractory Neuroblastoma, Refractory Non-Hodgkin Lymphoma, Refractory Osteosarcoma, Refractory Peripheral Primitive Neuroectodermal Tumor, Refractory Primary Central Nervous System Neoplasm, Refractory Rhabdoid Tumor, Refractory Rhabdomyosarcoma, Rhabdoid Tumor, Stage III Osteosarcoma AJCC v7, Stage III Soft Tissue Sarcoma AJCC v7, Stage IV Osteosarcoma AJCC v7, Stage IV Soft Tissue Sarcoma AJCC v7, Stage IVA Osteosarcoma AJCC v7, Stage IVB Osteosarcoma AJCC v7, Wilms Tumor | 2316 | 2017-07-31 |
| NTRK3 fusion | Trametinib | NCT02465060 | ACTIVE_NOT_RECRUITING | PHASE2 | Advanced Lymphoma, Advanced Malignant Solid Neoplasm, Bladder Carcinoma, Breast Carcinoma, Cervical Carcinoma, Colon Carcinoma, Colorectal Carcinoma, Endometrial Carcinoma, Esophageal Carcinoma, Exocrine Pancreas Carcinoma, Gastric Carcinoma, Glioma, Head and Neck Carcinoma, Hematopoietic and Lymphoid Cell Neoplasm, Kidney Carcinoma, Liver Carcinoma, Lung Carcinoma, Lymphoma, Malignant Uterine Corpus Neoplasm, Malignant Uterine Neoplasm, Melanoma, Multiple Myeloma, Ovarian Carcinoma, Prostate Carcinoma, Rectal Carcinoma, Recurrent Bladder Carcinoma, Recurrent Breast Carcinoma, Recurrent Cervical Carcinoma, Recurrent Colon Carcinoma, Recurrent Colorectal Carcinoma, Recurrent Esophageal Carcinoma, Recurrent Gastric Carcinoma, Recurrent Glioma, Recurrent Head and Neck Carcinoma, Recurrent Liver Carcinoma, Recurrent Lung Carcinoma, Recurrent Lymphoma, Recurrent Malignant Solid Neoplasm, Recurrent Malignant Uterine Corpus Neoplasm, Recurrent Melanoma, Recurrent Multiple Myeloma, Recurrent Ovarian Carcinoma, Recurrent Pancreatic Carcinoma, Recurrent Prostate Carcinoma, Recurrent Rectal Carcinoma, Recurrent Skin Carcinoma, Recurrent Thyroid Gland Carcinoma, Refractory Lymphoma, Refractory Malignant Solid Neoplasm, Refractory Multiple Myeloma, Skin Carcinoma, Thyroid Gland Carcinoma | 6452 | 2015-08-17 |
| NTRK3 fusion | Tyrosine | NCT02465060 | ACTIVE_NOT_RECRUITING | PHASE2 | Advanced Lymphoma, Advanced Malignant Solid Neoplasm, Bladder Carcinoma, Breast Carcinoma, Cervical Carcinoma, Colon Carcinoma, Colorectal Carcinoma, Endometrial Carcinoma, Esophageal Carcinoma, Exocrine Pancreas Carcinoma, Gastric Carcinoma, Glioma, Head and Neck Carcinoma, Hematopoietic and Lymphoid Cell Neoplasm, Kidney Carcinoma, Liver Carcinoma, Lung Carcinoma, Lymphoma, Malignant Uterine Corpus Neoplasm, Malignant Uterine Neoplasm, Melanoma, Multiple Myeloma, Ovarian Carcinoma, Prostate Carcinoma, Rectal Carcinoma, Recurrent Bladder Carcinoma, Recurrent Breast Carcinoma, Recurrent Cervical Carcinoma, Recurrent Colon Carcinoma, Recurrent Colorectal Carcinoma, Recurrent Esophageal Carcinoma, Recurrent Gastric Carcinoma, Recurrent Glioma, Recurrent Head and Neck Carcinoma, Recurrent Liver Carcinoma, Recurrent Lung Carcinoma, Recurrent Lymphoma, Recurrent Malignant Solid Neoplasm, Recurrent Malignant Uterine Corpus Neoplasm, Recurrent Melanoma, Recurrent Multiple Myeloma, Recurrent Ovarian Carcinoma, Recurrent Pancreatic Carcinoma, Recurrent Prostate Carcinoma, Recurrent Rectal Carcinoma, Recurrent Skin Carcinoma, Recurrent Thyroid Gland Carcinoma, Refractory Lymphoma, Refractory Malignant Solid Neoplasm, Refractory Multiple Myeloma, Skin Carcinoma, Thyroid Gland Carcinoma | 6452 | 2015-08-17 |
| NTRK3 fusion | Tyrosine | NCT02576431 | ACTIVE_NOT_RECRUITING | PHASE2 | Solid Tumors Harboring NTRK Fusion | 215 | 2015-09-30 |
| NTRK3 fusion | Tyrosine | NCT02637687 | ACTIVE_NOT_RECRUITING | PHASE1, PHASE2 | Solid Tumors Harboring NTRK Fusion | 154 | 2015-12-16 |
| NTRK3 fusion | Tyrosine | NCT02650401 | ACTIVE_NOT_RECRUITING | PHASE1, PHASE2 | Solid Tumors, CNS Tumors | 69 | 2016-05-03 |
| NTRK3 fusion | Tyrosine | NCT04557813 | ACTIVE_NOT_RECRUITING | Unknown | NTRK Family Gene Mutation | 88 | 2020-12-02 |
| NTRK3 fusion | Larotrectinib | NCT03025360 | APPROVED_FOR_MARKETING | Unknown | Tumors Harboring NTRK Fusion | Unknown | Unknown |
| NTRK3 fusion | Tyrosine | NCT03025360 | APPROVED_FOR_MARKETING | Unknown | Tumors Harboring NTRK Fusion | Unknown | Unknown |
| NTRK3 fusion | Larotrectinib | NCT02122913 | COMPLETED | PHASE1 | Solid Tumors Harboring NTRK Fusion | 75 | 2014-05-04 |
| NTRK3 fusion | Selitrectinib | NCT03215511 | COMPLETED | PHASE1 | Solid Tumors Harboring NTRK Fusion | 81 | 2017-07-03 |
| NTRK3 fusion | Tyrosine | NCT02122913 | COMPLETED | PHASE1 | Solid Tumors Harboring NTRK Fusion | 75 | 2014-05-04 |
| NTRK3 fusion | Tyrosine | NCT03215511 | COMPLETED | PHASE1 | Solid Tumors Harboring NTRK Fusion | 81 | 2017-07-03 |
| NTRK3 fusion | Selitrectinib | NCT03206931 | NO_LONGER_AVAILABLE | Unknown | Solid Tumors Harboring NTRK Fusion | Unknown | Unknown |
| NTRK3 fusion | Tyrosine | NCT03206931 | NO_LONGER_AVAILABLE | Unknown | Solid Tumors Harboring NTRK Fusion | Unknown | Unknown |
| NTRK3 fusion | Entrectinib | NCT02587650 | TERMINATED | PHASE2 | ALK Fusion Protein Expression, BRAF wt Allele, Invasive Skin Melanoma, MET Fusion Gene Positive, NRAS wt Allele, NTRK1 Fusion Positive, NTRK2 Fusion Positive, NTRK3 Fusion Positive, RET Fusion Positive, ROS1 Fusion Positive, Stage III Cutaneous Melanoma, Stage IIIA Cutaneous Melanoma, Stage IIIB Cutaneous Melanoma, Stage IIIC Cutaneous Melanoma, Stage IV Cutaneous Melanoma | 1 | 2015-03-26 |
| NTRK3 fusion | Tyrosine | NCT02587650 | TERMINATED | PHASE2 | ALK Fusion Protein Expression, BRAF wt Allele, Invasive Skin Melanoma, MET Fusion Gene Positive, NRAS wt Allele, NTRK1 Fusion Positive, NTRK2 Fusion Positive, NTRK3 Fusion Positive, RET Fusion Positive, ROS1 Fusion Positive, Stage III Cutaneous Melanoma, Stage IIIA Cutaneous Melanoma, Stage IIIB Cutaneous Melanoma, Stage IIIC Cutaneous Melanoma, Stage IV Cutaneous Melanoma | 1 | 2015-03-26 |
| NTRK3 fusion | Crizotinib | NCT02465060 | ACTIVE_NOT_RECRUITING | PHASE2 | Advanced Lymphoma, Advanced Malignant Solid Neoplasm, Bladder Carcinoma, Breast Carcinoma, Cervical Carcinoma, Colon Carcinoma, Colorectal Carcinoma, Endometrial Carcinoma, Esophageal Carcinoma, Exocrine Pancreas Carcinoma, Gastric Carcinoma, Glioma, Head and Neck Carcinoma, Hematopoietic and Lymphoid Cell Neoplasm, Kidney Carcinoma, Liver Carcinoma, Lung Carcinoma, Lymphoma, Malignant Uterine Corpus Neoplasm, Malignant Uterine Neoplasm, Melanoma, Multiple Myeloma, Ovarian Carcinoma, Prostate Carcinoma, Rectal Carcinoma, Recurrent Bladder Carcinoma, Recurrent Breast Carcinoma, Recurrent Cervical Carcinoma, Recurrent Colon Carcinoma, Recurrent Colorectal Carcinoma, Recurrent Esophageal Carcinoma, Recurrent Gastric Carcinoma, Recurrent Glioma, Recurrent Head and Neck Carcinoma, Recurrent Liver Carcinoma, Recurrent Lung Carcinoma, Recurrent Lymphoma, Recurrent Malignant Solid Neoplasm, Recurrent Malignant Uterine Corpus Neoplasm, Recurrent Melanoma, Recurrent Multiple Myeloma, Recurrent Ovarian Carcinoma, Recurrent Pancreatic Carcinoma, Recurrent Prostate Carcinoma, Recurrent Rectal Carcinoma, Recurrent Skin Carcinoma, Recurrent Thyroid Gland Carcinoma, Refractory Lymphoma, Refractory Malignant Solid Neoplasm, Refractory Multiple Myeloma, Skin Carcinoma, Thyroid Gland Carcinoma | 6452 | 2015-08-17 |
| NTRK3 fusion | Crizotinib | NCT02568267 | ACTIVE_NOT_RECRUITING | PHASE2 | Breast Cancer, Cholangiocarcinoma, Colorectal Cancer, Head and Neck Neoplasms, Lymphoma, Large-Cell, Anaplastic, Melanoma, Neuroendocrine Tumors, Non-Small Cell Lung Cancer, Ovarian Cancer, Pancreatic Cancer, Papillary Thyroid Cancer, Primary Brain Tumors, Renal Cell Carcinoma, Sarcomas, Salivary Gland Cancers, Adult Solid Tumor | 534 | 2015-11-19 |
| NTRK3 fusion | Entrectinib | NCT02568267 | ACTIVE_NOT_RECRUITING | PHASE2 | Breast Cancer, Cholangiocarcinoma, Colorectal Cancer, Head and Neck Neoplasms, Lymphoma, Large-Cell, Anaplastic, Melanoma, Neuroendocrine Tumors, Non-Small Cell Lung Cancer, Ovarian Cancer, Pancreatic Cancer, Papillary Thyroid Cancer, Primary Brain Tumors, Renal Cell Carcinoma, Sarcomas, Salivary Gland Cancers, Adult Solid Tumor | 534 | 2015-11-19 |
| NTRK3 fusion | Entrectinib | NCT02650401 | ACTIVE_NOT_RECRUITING | PHASE1, PHASE2 | Solid Tumors, CNS Tumors | 69 | 2016-05-03 |
| NTRK3 fusion | Entrectinib | NCT03375437 | ACTIVE_NOT_RECRUITING | NA | Soft Tissue Sarcoma, Advanced Cancer, Metastatic Cancer | 376 | 2018-02-15 |
| NTRK3 fusion | Iodine | NCT04970134 | ACTIVE_NOT_RECRUITING | Unknown | Differentiated Thyroid Carcinoma, Medullary Thyroid Carcinoma | 150 | 2021-06-14 |
| NTRK3 fusion | Larotrectinib | NCT02465060 | ACTIVE_NOT_RECRUITING | PHASE2 | Advanced Lymphoma, Advanced Malignant Solid Neoplasm, Bladder Carcinoma, Breast Carcinoma, Cervical Carcinoma, Colon Carcinoma, Colorectal Carcinoma, Endometrial Carcinoma, Esophageal Carcinoma, Exocrine Pancreas Carcinoma, Gastric Carcinoma, Glioma, Head and Neck Carcinoma, Hematopoietic and Lymphoid Cell Neoplasm, Kidney Carcinoma, Liver Carcinoma, Lung Carcinoma, Lymphoma, Malignant Uterine Corpus Neoplasm, Malignant Uterine Neoplasm, Melanoma, Multiple Myeloma, Ovarian Carcinoma, Prostate Carcinoma, Rectal Carcinoma, Recurrent Bladder Carcinoma, Recurrent Breast Carcinoma, Recurrent Cervical Carcinoma, Recurrent Colon Carcinoma, Recurrent Colorectal Carcinoma, Recurrent Esophageal Carcinoma, Recurrent Gastric Carcinoma, Recurrent Glioma, Recurrent Head and Neck Carcinoma, Recurrent Liver Carcinoma, Recurrent Lung Carcinoma, Recurrent Lymphoma, Recurrent Malignant Solid Neoplasm, Recurrent Malignant Uterine Corpus Neoplasm, Recurrent Melanoma, Recurrent Multiple Myeloma, Recurrent Ovarian Carcinoma, Recurrent Pancreatic Carcinoma, Recurrent Prostate Carcinoma, Recurrent Rectal Carcinoma, Recurrent Skin Carcinoma, Recurrent Thyroid Gland Carcinoma, Refractory Lymphoma, Refractory Malignant Solid Neoplasm, Refractory Multiple Myeloma, Skin Carcinoma, Thyroid Gland Carcinoma | 6452 | 2015-08-17 |
| NTRK3 fusion | Larotrectinib | NCT02576431 | ACTIVE_NOT_RECRUITING | PHASE2 | Solid Tumors Harboring NTRK Fusion | 215 | 2015-09-30 |
| NTRK3 fusion | Larotrectinib | NCT02637687 | ACTIVE_NOT_RECRUITING | PHASE1, PHASE2 | Solid Tumors Harboring NTRK Fusion | 154 | 2015-12-16 |
| NTRK3 fusion | Larotrectinib | NCT03155620 | ACTIVE_NOT_RECRUITING | PHASE2 | Advanced Malignant Solid Neoplasm, Ann Arbor Stage III Non-Hodgkin Lymphoma, Ann Arbor Stage IV Non-Hodgkin Lymphoma, Histiocytic Sarcoma, Juvenile Xanthogranuloma, Langerhans Cell Histiocytosis, Malignant Glioma, Recurrent Childhood Rhabdomyosarcoma, Recurrent Ependymoma, Recurrent Ewing Sarcoma, Recurrent Glioma, Recurrent Hepatoblastoma, Recurrent Langerhans Cell Histiocytosis, Recurrent Malignant Germ Cell Tumor, Recurrent Malignant Solid Neoplasm, Recurrent Medulloblastoma, Recurrent Neuroblastoma, Recurrent Non-Hodgkin Lymphoma, Recurrent Osteosarcoma, Recurrent Peripheral Primitive Neuroectodermal Tumor, Recurrent Primary Central Nervous System Neoplasm, Recurrent Rhabdoid Tumor, Recurrent Soft Tissue Sarcoma, Refractory Ewing Sarcoma, Refractory Glioma, Refractory Hepatoblastoma, Refractory Langerhans Cell Histiocytosis, Refractory Malignant Germ Cell Tumor, Refractory Malignant Solid Neoplasm, Refractory Medulloblastoma, Refractory Neuroblastoma, Refractory Non-Hodgkin Lymphoma, Refractory Osteosarcoma, Refractory Peripheral Primitive Neuroectodermal Tumor, Refractory Primary Central Nervous System Neoplasm, Refractory Rhabdoid Tumor, Refractory Rhabdomyosarcoma, Rhabdoid Tumor, Stage III Osteosarcoma AJCC v7, Stage III Soft Tissue Sarcoma AJCC v7, Stage IV Osteosarcoma AJCC v7, Stage IV Soft Tissue Sarcoma AJCC v7, Stage IVA Osteosarcoma AJCC v7, Stage IVB Osteosarcoma AJCC v7, Wilms Tumor | 2316 | 2017-07-31 |
| NTRK3 fusion | MCC | NCT02465060 | ACTIVE_NOT_RECRUITING | PHASE2 | Advanced Lymphoma, Advanced Malignant Solid Neoplasm, Bladder Carcinoma, Breast Carcinoma, Cervical Carcinoma, Colon Carcinoma, Colorectal Carcinoma, Endometrial Carcinoma, Esophageal Carcinoma, Exocrine Pancreas Carcinoma, Gastric Carcinoma, Glioma, Head and Neck Carcinoma, Hematopoietic and Lymphoid Cell Neoplasm, Kidney Carcinoma, Liver Carcinoma, Lung Carcinoma, Lymphoma, Malignant Uterine Corpus Neoplasm, Malignant Uterine Neoplasm, Melanoma, Multiple Myeloma, Ovarian Carcinoma, Prostate Carcinoma, Rectal Carcinoma, Recurrent Bladder Carcinoma, Recurrent Breast Carcinoma, Recurrent Cervical Carcinoma, Recurrent Colon Carcinoma, Recurrent Colorectal Carcinoma, Recurrent Esophageal Carcinoma, Recurrent Gastric Carcinoma, Recurrent Glioma, Recurrent Head and Neck Carcinoma, Recurrent Liver Carcinoma, Recurrent Lung Carcinoma, Recurrent Lymphoma, Recurrent Malignant Solid Neoplasm, Recurrent Malignant Uterine Corpus Neoplasm, Recurrent Melanoma, Recurrent Multiple Myeloma, Recurrent Ovarian Carcinoma, Recurrent Pancreatic Carcinoma, Recurrent Prostate Carcinoma, Recurrent Rectal Carcinoma, Recurrent Skin Carcinoma, Recurrent Thyroid Gland Carcinoma, Refractory Lymphoma, Refractory Malignant Solid Neoplasm, Refractory Multiple Myeloma, Skin Carcinoma, Thyroid Gland Carcinoma | 6452 | 2015-08-17 |
| NTRK3 fusion | Ribose | NCT03155620 | ACTIVE_NOT_RECRUITING | PHASE2 | Advanced Malignant Solid Neoplasm, Ann Arbor Stage III Non-Hodgkin Lymphoma, Ann Arbor Stage IV Non-Hodgkin Lymphoma, Histiocytic Sarcoma, Juvenile Xanthogranuloma, Langerhans Cell Histiocytosis, Malignant Glioma, Recurrent Childhood Rhabdomyosarcoma, Recurrent Ependymoma, Recurrent Ewing Sarcoma, Recurrent Glioma, Recurrent Hepatoblastoma, Recurrent Langerhans Cell Histiocytosis, Recurrent Malignant Germ Cell Tumor, Recurrent Malignant Solid Neoplasm, Recurrent Medulloblastoma, Recurrent Neuroblastoma, Recurrent Non-Hodgkin Lymphoma, Recurrent Osteosarcoma, Recurrent Peripheral Primitive Neuroectodermal Tumor, Recurrent Primary Central Nervous System Neoplasm, Recurrent Rhabdoid Tumor, Recurrent Soft Tissue Sarcoma, Refractory Ewing Sarcoma, Refractory Glioma, Refractory Hepatoblastoma, Refractory Langerhans Cell Histiocytosis, Refractory Malignant Germ Cell Tumor, Refractory Malignant Solid Neoplasm, Refractory Medulloblastoma, Refractory Neuroblastoma, Refractory Non-Hodgkin Lymphoma, Refractory Osteosarcoma, Refractory Peripheral Primitive Neuroectodermal Tumor, Refractory Primary Central Nervous System Neoplasm, Refractory Rhabdoid Tumor, Refractory Rhabdomyosarcoma, Rhabdoid Tumor, Stage III Osteosarcoma AJCC v7, Stage III Soft Tissue Sarcoma AJCC v7, Stage IV Osteosarcoma AJCC v7, Stage IV Soft Tissue Sarcoma AJCC v7, Stage IVA Osteosarcoma AJCC v7, Stage IVB Osteosarcoma AJCC v7, Wilms Tumor | 2316 | 2017-07-31 |
| NTRK3 fusion | Selpercatinib | NCT03155620 | ACTIVE_NOT_RECRUITING | PHASE2 | Advanced Malignant Solid Neoplasm, Ann Arbor Stage III Non-Hodgkin Lymphoma, Ann Arbor Stage IV Non-Hodgkin Lymphoma, Histiocytic Sarcoma, Juvenile Xanthogranuloma, Langerhans Cell Histiocytosis, Malignant Glioma, Recurrent Childhood Rhabdomyosarcoma, Recurrent Ependymoma, Recurrent Ewing Sarcoma, Recurrent Glioma, Recurrent Hepatoblastoma, Recurrent Langerhans Cell Histiocytosis, Recurrent Malignant Germ Cell Tumor, Recurrent Malignant Solid Neoplasm, Recurrent Medulloblastoma, Recurrent Neuroblastoma, Recurrent Non-Hodgkin Lymphoma, Recurrent Osteosarcoma, Recurrent Peripheral Primitive Neuroectodermal Tumor, Recurrent Primary Central Nervous System Neoplasm, Recurrent Rhabdoid Tumor, Recurrent Soft Tissue Sarcoma, Refractory Ewing Sarcoma, Refractory Glioma, Refractory Hepatoblastoma, Refractory Langerhans Cell Histiocytosis, Refractory Malignant Germ Cell Tumor, Refractory Malignant Solid Neoplasm, Refractory Medulloblastoma, Refractory Neuroblastoma, Refractory Non-Hodgkin Lymphoma, Refractory Osteosarcoma, Refractory Peripheral Primitive Neuroectodermal Tumor, Refractory Primary Central Nervous System Neoplasm, Refractory Rhabdoid Tumor, Refractory Rhabdomyosarcoma, Rhabdoid Tumor, Stage III Osteosarcoma AJCC v7, Stage III Soft Tissue Sarcoma AJCC v7, Stage IV Osteosarcoma AJCC v7, Stage IV Soft Tissue Sarcoma AJCC v7, Stage IVA Osteosarcoma AJCC v7, Stage IVB Osteosarcoma AJCC v7, Wilms Tumor | 2316 | 2017-07-31 |
| NTRK3 fusion | Trametinib | NCT02465060 | ACTIVE_NOT_RECRUITING | PHASE2 | Advanced Lymphoma, Advanced Malignant Solid Neoplasm, Bladder Carcinoma, Breast Carcinoma, Cervical Carcinoma, Colon Carcinoma, Colorectal Carcinoma, Endometrial Carcinoma, Esophageal Carcinoma, Exocrine Pancreas Carcinoma, Gastric Carcinoma, Glioma, Head and Neck Carcinoma, Hematopoietic and Lymphoid Cell Neoplasm, Kidney Carcinoma, Liver Carcinoma, Lung Carcinoma, Lymphoma, Malignant Uterine Corpus Neoplasm, Malignant Uterine Neoplasm, Melanoma, Multiple Myeloma, Ovarian Carcinoma, Prostate Carcinoma, Rectal Carcinoma, Recurrent Bladder Carcinoma, Recurrent Breast Carcinoma, Recurrent Cervical Carcinoma, Recurrent Colon Carcinoma, Recurrent Colorectal Carcinoma, Recurrent Esophageal Carcinoma, Recurrent Gastric Carcinoma, Recurrent Glioma, Recurrent Head and Neck Carcinoma, Recurrent Liver Carcinoma, Recurrent Lung Carcinoma, Recurrent Lymphoma, Recurrent Malignant Solid Neoplasm, Recurrent Malignant Uterine Corpus Neoplasm, Recurrent Melanoma, Recurrent Multiple Myeloma, Recurrent Ovarian Carcinoma, Recurrent Pancreatic Carcinoma, Recurrent Prostate Carcinoma, Recurrent Rectal Carcinoma, Recurrent Skin Carcinoma, Recurrent Thyroid Gland Carcinoma, Refractory Lymphoma, Refractory Malignant Solid Neoplasm, Refractory Multiple Myeloma, Skin Carcinoma, Thyroid Gland Carcinoma | 6452 | 2015-08-17 |
| NTRK3 fusion | Tyrosine | NCT02465060 | ACTIVE_NOT_RECRUITING | PHASE2 | Advanced Lymphoma, Advanced Malignant Solid Neoplasm, Bladder Carcinoma, Breast Carcinoma, Cervical Carcinoma, Colon Carcinoma, Colorectal Carcinoma, Endometrial Carcinoma, Esophageal Carcinoma, Exocrine Pancreas Carcinoma, Gastric Carcinoma, Glioma, Head and Neck Carcinoma, Hematopoietic and Lymphoid Cell Neoplasm, Kidney Carcinoma, Liver Carcinoma, Lung Carcinoma, Lymphoma, Malignant Uterine Corpus Neoplasm, Malignant Uterine Neoplasm, Melanoma, Multiple Myeloma, Ovarian Carcinoma, Prostate Carcinoma, Rectal Carcinoma, Recurrent Bladder Carcinoma, Recurrent Breast Carcinoma, Recurrent Cervical Carcinoma, Recurrent Colon Carcinoma, Recurrent Colorectal Carcinoma, Recurrent Esophageal Carcinoma, Recurrent Gastric Carcinoma, Recurrent Glioma, Recurrent Head and Neck Carcinoma, Recurrent Liver Carcinoma, Recurrent Lung Carcinoma, Recurrent Lymphoma, Recurrent Malignant Solid Neoplasm, Recurrent Malignant Uterine Corpus Neoplasm, Recurrent Melanoma, Recurrent Multiple Myeloma, Recurrent Ovarian Carcinoma, Recurrent Pancreatic Carcinoma, Recurrent Prostate Carcinoma, Recurrent Rectal Carcinoma, Recurrent Skin Carcinoma, Recurrent Thyroid Gland Carcinoma, Refractory Lymphoma, Refractory Malignant Solid Neoplasm, Refractory Multiple Myeloma, Skin Carcinoma, Thyroid Gland Carcinoma | 6452 | 2015-08-17 |
| NTRK3 fusion | Tyrosine | NCT02576431 | ACTIVE_NOT_RECRUITING | PHASE2 | Solid Tumors Harboring NTRK Fusion | 215 | 2015-09-30 |
| NTRK3 fusion | Tyrosine | NCT02637687 | ACTIVE_NOT_RECRUITING | PHASE1, PHASE2 | Solid Tumors Harboring NTRK Fusion | 154 | 2015-12-16 |
| NTRK3 fusion | Tyrosine | NCT02650401 | ACTIVE_NOT_RECRUITING | PHASE1, PHASE2 | Solid Tumors, CNS Tumors | 69 | 2016-05-03 |
| NTRK3 fusion | Tyrosine | NCT04557813 | ACTIVE_NOT_RECRUITING | Unknown | NTRK Family Gene Mutation | 88 | 2020-12-02 |
| NTRK3 fusion | Larotrectinib | NCT03025360 | APPROVED_FOR_MARKETING | Unknown | Tumors Harboring NTRK Fusion | Unknown | Unknown |
| NTRK3 fusion | Tyrosine | NCT03025360 | APPROVED_FOR_MARKETING | Unknown | Tumors Harboring NTRK Fusion | Unknown | Unknown |
| NTRK3 fusion | Larotrectinib | NCT02122913 | COMPLETED | PHASE1 | Solid Tumors Harboring NTRK Fusion | 75 | 2014-05-04 |
| NTRK3 fusion | Selitrectinib | NCT03215511 | COMPLETED | PHASE1 | Solid Tumors Harboring NTRK Fusion | 81 | 2017-07-03 |
| NTRK3 fusion | Tyrosine | NCT02122913 | COMPLETED | PHASE1 | Solid Tumors Harboring NTRK Fusion | 75 | 2014-05-04 |
| NTRK3 fusion | Tyrosine | NCT03215511 | COMPLETED | PHASE1 | Solid Tumors Harboring NTRK Fusion | 81 | 2017-07-03 |
| NTRK3 fusion | Selitrectinib | NCT03206931 | NO_LONGER_AVAILABLE | Unknown | Solid Tumors Harboring NTRK Fusion | Unknown | Unknown |
| NTRK3 fusion | Tyrosine | NCT03206931 | NO_LONGER_AVAILABLE | Unknown | Solid Tumors Harboring NTRK Fusion | Unknown | Unknown |
| NTRK3 fusion | Entrectinib | NCT02587650 | TERMINATED | PHASE2 | ALK Fusion Protein Expression, BRAF wt Allele, Invasive Skin Melanoma, MET Fusion Gene Positive, NRAS wt Allele, NTRK1 Fusion Positive, NTRK2 Fusion Positive, NTRK3 Fusion Positive, RET Fusion Positive, ROS1 Fusion Positive, Stage III Cutaneous Melanoma, Stage IIIA Cutaneous Melanoma, Stage IIIB Cutaneous Melanoma, Stage IIIC Cutaneous Melanoma, Stage IV Cutaneous Melanoma | 1 | 2015-03-26 |
| NTRK3 fusion | Tyrosine | NCT02587650 | TERMINATED | PHASE2 | ALK Fusion Protein Expression, BRAF wt Allele, Invasive Skin Melanoma, MET Fusion Gene Positive, NRAS wt Allele, NTRK1 Fusion Positive, NTRK2 Fusion Positive, NTRK3 Fusion Positive, RET Fusion Positive, ROS1 Fusion Positive, Stage III Cutaneous Melanoma, Stage IIIA Cutaneous Melanoma, Stage IIIB Cutaneous Melanoma, Stage IIIC Cutaneous Melanoma, Stage IV Cutaneous Melanoma | 1 | 2015-03-26 |
| NTRK3 fusion | Crizotinib | NCT02465060 | ACTIVE_NOT_RECRUITING | PHASE2 | Advanced Lymphoma, Advanced Malignant Solid Neoplasm, Bladder Carcinoma, Breast Carcinoma, Cervical Carcinoma, Colon Carcinoma, Colorectal Carcinoma, Endometrial Carcinoma, Esophageal Carcinoma, Exocrine Pancreas Carcinoma, Gastric Carcinoma, Glioma, Head and Neck Carcinoma, Hematopoietic and Lymphoid Cell Neoplasm, Kidney Carcinoma, Liver Carcinoma, Lung Carcinoma, Lymphoma, Malignant Uterine Corpus Neoplasm, Malignant Uterine Neoplasm, Melanoma, Multiple Myeloma, Ovarian Carcinoma, Prostate Carcinoma, Rectal Carcinoma, Recurrent Bladder Carcinoma, Recurrent Breast Carcinoma, Recurrent Cervical Carcinoma, Recurrent Colon Carcinoma, Recurrent Colorectal Carcinoma, Recurrent Esophageal Carcinoma, Recurrent Gastric Carcinoma, Recurrent Glioma, Recurrent Head and Neck Carcinoma, Recurrent Liver Carcinoma, Recurrent Lung Carcinoma, Recurrent Lymphoma, Recurrent Malignant Solid Neoplasm, Recurrent Malignant Uterine Corpus Neoplasm, Recurrent Melanoma, Recurrent Multiple Myeloma, Recurrent Ovarian Carcinoma, Recurrent Pancreatic Carcinoma, Recurrent Prostate Carcinoma, Recurrent Rectal Carcinoma, Recurrent Skin Carcinoma, Recurrent Thyroid Gland Carcinoma, Refractory Lymphoma, Refractory Malignant Solid Neoplasm, Refractory Multiple Myeloma, Skin Carcinoma, Thyroid Gland Carcinoma | 6452 | 2015-08-17 |
| NTRK3 fusion | Crizotinib | NCT02568267 | ACTIVE_NOT_RECRUITING | PHASE2 | Breast Cancer, Cholangiocarcinoma, Colorectal Cancer, Head and Neck Neoplasms, Lymphoma, Large-Cell, Anaplastic, Melanoma, Neuroendocrine Tumors, Non-Small Cell Lung Cancer, Ovarian Cancer, Pancreatic Cancer, Papillary Thyroid Cancer, Primary Brain Tumors, Renal Cell Carcinoma, Sarcomas, Salivary Gland Cancers, Adult Solid Tumor | 534 | 2015-11-19 |
| NTRK3 fusion | Entrectinib | NCT02568267 | ACTIVE_NOT_RECRUITING | PHASE2 | Breast Cancer, Cholangiocarcinoma, Colorectal Cancer, Head and Neck Neoplasms, Lymphoma, Large-Cell, Anaplastic, Melanoma, Neuroendocrine Tumors, Non-Small Cell Lung Cancer, Ovarian Cancer, Pancreatic Cancer, Papillary Thyroid Cancer, Primary Brain Tumors, Renal Cell Carcinoma, Sarcomas, Salivary Gland Cancers, Adult Solid Tumor | 534 | 2015-11-19 |
| NTRK3 fusion | Entrectinib | NCT02650401 | ACTIVE_NOT_RECRUITING | PHASE1, PHASE2 | Solid Tumors, CNS Tumors | 69 | 2016-05-03 |
| NTRK3 fusion | Entrectinib | NCT03375437 | ACTIVE_NOT_RECRUITING | NA | Soft Tissue Sarcoma, Advanced Cancer, Metastatic Cancer | 376 | 2018-02-15 |
| NTRK3 fusion | Iodine | NCT04970134 | ACTIVE_NOT_RECRUITING | Unknown | Differentiated Thyroid Carcinoma, Medullary Thyroid Carcinoma | 150 | 2021-06-14 |
| NTRK3 fusion | Larotrectinib | NCT02465060 | ACTIVE_NOT_RECRUITING | PHASE2 | Advanced Lymphoma, Advanced Malignant Solid Neoplasm, Bladder Carcinoma, Breast Carcinoma, Cervical Carcinoma, Colon Carcinoma, Colorectal Carcinoma, Endometrial Carcinoma, Esophageal Carcinoma, Exocrine Pancreas Carcinoma, Gastric Carcinoma, Glioma, Head and Neck Carcinoma, Hematopoietic and Lymphoid Cell Neoplasm, Kidney Carcinoma, Liver Carcinoma, Lung Carcinoma, Lymphoma, Malignant Uterine Corpus Neoplasm, Malignant Uterine Neoplasm, Melanoma, Multiple Myeloma, Ovarian Carcinoma, Prostate Carcinoma, Rectal Carcinoma, Recurrent Bladder Carcinoma, Recurrent Breast Carcinoma, Recurrent Cervical Carcinoma, Recurrent Colon Carcinoma, Recurrent Colorectal Carcinoma, Recurrent Esophageal Carcinoma, Recurrent Gastric Carcinoma, Recurrent Glioma, Recurrent Head and Neck Carcinoma, Recurrent Liver Carcinoma, Recurrent Lung Carcinoma, Recurrent Lymphoma, Recurrent Malignant Solid Neoplasm, Recurrent Malignant Uterine Corpus Neoplasm, Recurrent Melanoma, Recurrent Multiple Myeloma, Recurrent Ovarian Carcinoma, Recurrent Pancreatic Carcinoma, Recurrent Prostate Carcinoma, Recurrent Rectal Carcinoma, Recurrent Skin Carcinoma, Recurrent Thyroid Gland Carcinoma, Refractory Lymphoma, Refractory Malignant Solid Neoplasm, Refractory Multiple Myeloma, Skin Carcinoma, Thyroid Gland Carcinoma | 6452 | 2015-08-17 |
| NTRK3 fusion | Larotrectinib | NCT02576431 | ACTIVE_NOT_RECRUITING | PHASE2 | Solid Tumors Harboring NTRK Fusion | 215 | 2015-09-30 |
| NTRK3 fusion | Larotrectinib | NCT02637687 | ACTIVE_NOT_RECRUITING | PHASE1, PHASE2 | Solid Tumors Harboring NTRK Fusion | 154 | 2015-12-16 |
| NTRK3 fusion | Larotrectinib | NCT03155620 | ACTIVE_NOT_RECRUITING | PHASE2 | Advanced Malignant Solid Neoplasm, Ann Arbor Stage III Non-Hodgkin Lymphoma, Ann Arbor Stage IV Non-Hodgkin Lymphoma, Histiocytic Sarcoma, Juvenile Xanthogranuloma, Langerhans Cell Histiocytosis, Malignant Glioma, Recurrent Childhood Rhabdomyosarcoma, Recurrent Ependymoma, Recurrent Ewing Sarcoma, Recurrent Glioma, Recurrent Hepatoblastoma, Recurrent Langerhans Cell Histiocytosis, Recurrent Malignant Germ Cell Tumor, Recurrent Malignant Solid Neoplasm, Recurrent Medulloblastoma, Recurrent Neuroblastoma, Recurrent Non-Hodgkin Lymphoma, Recurrent Osteosarcoma, Recurrent Peripheral Primitive Neuroectodermal Tumor, Recurrent Primary Central Nervous System Neoplasm, Recurrent Rhabdoid Tumor, Recurrent Soft Tissue Sarcoma, Refractory Ewing Sarcoma, Refractory Glioma, Refractory Hepatoblastoma, Refractory Langerhans Cell Histiocytosis, Refractory Malignant Germ Cell Tumor, Refractory Malignant Solid Neoplasm, Refractory Medulloblastoma, Refractory Neuroblastoma, Refractory Non-Hodgkin Lymphoma, Refractory Osteosarcoma, Refractory Peripheral Primitive Neuroectodermal Tumor, Refractory Primary Central Nervous System Neoplasm, Refractory Rhabdoid Tumor, Refractory Rhabdomyosarcoma, Rhabdoid Tumor, Stage III Osteosarcoma AJCC v7, Stage III Soft Tissue Sarcoma AJCC v7, Stage IV Osteosarcoma AJCC v7, Stage IV Soft Tissue Sarcoma AJCC v7, Stage IVA Osteosarcoma AJCC v7, Stage IVB Osteosarcoma AJCC v7, Wilms Tumor | 2316 | 2017-07-31 |
| NTRK3 fusion | MCC | NCT02465060 | ACTIVE_NOT_RECRUITING | PHASE2 | Advanced Lymphoma, Advanced Malignant Solid Neoplasm, Bladder Carcinoma, Breast Carcinoma, Cervical Carcinoma, Colon Carcinoma, Colorectal Carcinoma, Endometrial Carcinoma, Esophageal Carcinoma, Exocrine Pancreas Carcinoma, Gastric Carcinoma, Glioma, Head and Neck Carcinoma, Hematopoietic and Lymphoid Cell Neoplasm, Kidney Carcinoma, Liver Carcinoma, Lung Carcinoma, Lymphoma, Malignant Uterine Corpus Neoplasm, Malignant Uterine Neoplasm, Melanoma, Multiple Myeloma, Ovarian Carcinoma, Prostate Carcinoma, Rectal Carcinoma, Recurrent Bladder Carcinoma, Recurrent Breast Carcinoma, Recurrent Cervical Carcinoma, Recurrent Colon Carcinoma, Recurrent Colorectal Carcinoma, Recurrent Esophageal Carcinoma, Recurrent Gastric Carcinoma, Recurrent Glioma, Recurrent Head and Neck Carcinoma, Recurrent Liver Carcinoma, Recurrent Lung Carcinoma, Recurrent Lymphoma, Recurrent Malignant Solid Neoplasm, Recurrent Malignant Uterine Corpus Neoplasm, Recurrent Melanoma, Recurrent Multiple Myeloma, Recurrent Ovarian Carcinoma, Recurrent Pancreatic Carcinoma, Recurrent Prostate Carcinoma, Recurrent Rectal Carcinoma, Recurrent Skin Carcinoma, Recurrent Thyroid Gland Carcinoma, Refractory Lymphoma, Refractory Malignant Solid Neoplasm, Refractory Multiple Myeloma, Skin Carcinoma, Thyroid Gland Carcinoma | 6452 | 2015-08-17 |
| NTRK3 fusion | Ribose | NCT03155620 | ACTIVE_NOT_RECRUITING | PHASE2 | Advanced Malignant Solid Neoplasm, Ann Arbor Stage III Non-Hodgkin Lymphoma, Ann Arbor Stage IV Non-Hodgkin Lymphoma, Histiocytic Sarcoma, Juvenile Xanthogranuloma, Langerhans Cell Histiocytosis, Malignant Glioma, Recurrent Childhood Rhabdomyosarcoma, Recurrent Ependymoma, Recurrent Ewing Sarcoma, Recurrent Glioma, Recurrent Hepatoblastoma, Recurrent Langerhans Cell Histiocytosis, Recurrent Malignant Germ Cell Tumor, Recurrent Malignant Solid Neoplasm, Recurrent Medulloblastoma, Recurrent Neuroblastoma, Recurrent Non-Hodgkin Lymphoma, Recurrent Osteosarcoma, Recurrent Peripheral Primitive Neuroectodermal Tumor, Recurrent Primary Central Nervous System Neoplasm, Recurrent Rhabdoid Tumor, Recurrent Soft Tissue Sarcoma, Refractory Ewing Sarcoma, Refractory Glioma, Refractory Hepatoblastoma, Refractory Langerhans Cell Histiocytosis, Refractory Malignant Germ Cell Tumor, Refractory Malignant Solid Neoplasm, Refractory Medulloblastoma, Refractory Neuroblastoma, Refractory Non-Hodgkin Lymphoma, Refractory Osteosarcoma, Refractory Peripheral Primitive Neuroectodermal Tumor, Refractory Primary Central Nervous System Neoplasm, Refractory Rhabdoid Tumor, Refractory Rhabdomyosarcoma, Rhabdoid Tumor, Stage III Osteosarcoma AJCC v7, Stage III Soft Tissue Sarcoma AJCC v7, Stage IV Osteosarcoma AJCC v7, Stage IV Soft Tissue Sarcoma AJCC v7, Stage IVA Osteosarcoma AJCC v7, Stage IVB Osteosarcoma AJCC v7, Wilms Tumor | 2316 | 2017-07-31 |
| NTRK3 fusion | Selpercatinib | NCT03155620 | ACTIVE_NOT_RECRUITING | PHASE2 | Advanced Malignant Solid Neoplasm, Ann Arbor Stage III Non-Hodgkin Lymphoma, Ann Arbor Stage IV Non-Hodgkin Lymphoma, Histiocytic Sarcoma, Juvenile Xanthogranuloma, Langerhans Cell Histiocytosis, Malignant Glioma, Recurrent Childhood Rhabdomyosarcoma, Recurrent Ependymoma, Recurrent Ewing Sarcoma, Recurrent Glioma, Recurrent Hepatoblastoma, Recurrent Langerhans Cell Histiocytosis, Recurrent Malignant Germ Cell Tumor, Recurrent Malignant Solid Neoplasm, Recurrent Medulloblastoma, Recurrent Neuroblastoma, Recurrent Non-Hodgkin Lymphoma, Recurrent Osteosarcoma, Recurrent Peripheral Primitive Neuroectodermal Tumor, Recurrent Primary Central Nervous System Neoplasm, Recurrent Rhabdoid Tumor, Recurrent Soft Tissue Sarcoma, Refractory Ewing Sarcoma, Refractory Glioma, Refractory Hepatoblastoma, Refractory Langerhans Cell Histiocytosis, Refractory Malignant Germ Cell Tumor, Refractory Malignant Solid Neoplasm, Refractory Medulloblastoma, Refractory Neuroblastoma, Refractory Non-Hodgkin Lymphoma, Refractory Osteosarcoma, Refractory Peripheral Primitive Neuroectodermal Tumor, Refractory Primary Central Nervous System Neoplasm, Refractory Rhabdoid Tumor, Refractory Rhabdomyosarcoma, Rhabdoid Tumor, Stage III Osteosarcoma AJCC v7, Stage III Soft Tissue Sarcoma AJCC v7, Stage IV Osteosarcoma AJCC v7, Stage IV Soft Tissue Sarcoma AJCC v7, Stage IVA Osteosarcoma AJCC v7, Stage IVB Osteosarcoma AJCC v7, Wilms Tumor | 2316 | 2017-07-31 |
| NTRK3 fusion | Trametinib | NCT02465060 | ACTIVE_NOT_RECRUITING | PHASE2 | Advanced Lymphoma, Advanced Malignant Solid Neoplasm, Bladder Carcinoma, Breast Carcinoma, Cervical Carcinoma, Colon Carcinoma, Colorectal Carcinoma, Endometrial Carcinoma, Esophageal Carcinoma, Exocrine Pancreas Carcinoma, Gastric Carcinoma, Glioma, Head and Neck Carcinoma, Hematopoietic and Lymphoid Cell Neoplasm, Kidney Carcinoma, Liver Carcinoma, Lung Carcinoma, Lymphoma, Malignant Uterine Corpus Neoplasm, Malignant Uterine Neoplasm, Melanoma, Multiple Myeloma, Ovarian Carcinoma, Prostate Carcinoma, Rectal Carcinoma, Recurrent Bladder Carcinoma, Recurrent Breast Carcinoma, Recurrent Cervical Carcinoma, Recurrent Colon Carcinoma, Recurrent Colorectal Carcinoma, Recurrent Esophageal Carcinoma, Recurrent Gastric Carcinoma, Recurrent Glioma, Recurrent Head and Neck Carcinoma, Recurrent Liver Carcinoma, Recurrent Lung Carcinoma, Recurrent Lymphoma, Recurrent Malignant Solid Neoplasm, Recurrent Malignant Uterine Corpus Neoplasm, Recurrent Melanoma, Recurrent Multiple Myeloma, Recurrent Ovarian Carcinoma, Recurrent Pancreatic Carcinoma, Recurrent Prostate Carcinoma, Recurrent Rectal Carcinoma, Recurrent Skin Carcinoma, Recurrent Thyroid Gland Carcinoma, Refractory Lymphoma, Refractory Malignant Solid Neoplasm, Refractory Multiple Myeloma, Skin Carcinoma, Thyroid Gland Carcinoma | 6452 | 2015-08-17 |
| NTRK3 fusion | Tyrosine | NCT02465060 | ACTIVE_NOT_RECRUITING | PHASE2 | Advanced Lymphoma, Advanced Malignant Solid Neoplasm, Bladder Carcinoma, Breast Carcinoma, Cervical Carcinoma, Colon Carcinoma, Colorectal Carcinoma, Endometrial Carcinoma, Esophageal Carcinoma, Exocrine Pancreas Carcinoma, Gastric Carcinoma, Glioma, Head and Neck Carcinoma, Hematopoietic and Lymphoid Cell Neoplasm, Kidney Carcinoma, Liver Carcinoma, Lung Carcinoma, Lymphoma, Malignant Uterine Corpus Neoplasm, Malignant Uterine Neoplasm, Melanoma, Multiple Myeloma, Ovarian Carcinoma, Prostate Carcinoma, Rectal Carcinoma, Recurrent Bladder Carcinoma, Recurrent Breast Carcinoma, Recurrent Cervical Carcinoma, Recurrent Colon Carcinoma, Recurrent Colorectal Carcinoma, Recurrent Esophageal Carcinoma, Recurrent Gastric Carcinoma, Recurrent Glioma, Recurrent Head and Neck Carcinoma, Recurrent Liver Carcinoma, Recurrent Lung Carcinoma, Recurrent Lymphoma, Recurrent Malignant Solid Neoplasm, Recurrent Malignant Uterine Corpus Neoplasm, Recurrent Melanoma, Recurrent Multiple Myeloma, Recurrent Ovarian Carcinoma, Recurrent Pancreatic Carcinoma, Recurrent Prostate Carcinoma, Recurrent Rectal Carcinoma, Recurrent Skin Carcinoma, Recurrent Thyroid Gland Carcinoma, Refractory Lymphoma, Refractory Malignant Solid Neoplasm, Refractory Multiple Myeloma, Skin Carcinoma, Thyroid Gland Carcinoma | 6452 | 2015-08-17 |
| NTRK3 fusion | Tyrosine | NCT02576431 | ACTIVE_NOT_RECRUITING | PHASE2 | Solid Tumors Harboring NTRK Fusion | 215 | 2015-09-30 |
| NTRK3 fusion | Tyrosine | NCT02637687 | ACTIVE_NOT_RECRUITING | PHASE1, PHASE2 | Solid Tumors Harboring NTRK Fusion | 154 | 2015-12-16 |
| NTRK3 fusion | Tyrosine | NCT02650401 | ACTIVE_NOT_RECRUITING | PHASE1, PHASE2 | Solid Tumors, CNS Tumors | 69 | 2016-05-03 |
| NTRK3 fusion | Tyrosine | NCT04557813 | ACTIVE_NOT_RECRUITING | Unknown | NTRK Family Gene Mutation | 88 | 2020-12-02 |
| NTRK3 fusion | Larotrectinib | NCT03025360 | APPROVED_FOR_MARKETING | Unknown | Tumors Harboring NTRK Fusion | Unknown | Unknown |
| NTRK3 fusion | Tyrosine | NCT03025360 | APPROVED_FOR_MARKETING | Unknown | Tumors Harboring NTRK Fusion | Unknown | Unknown |
| NTRK3 fusion | Larotrectinib | NCT02122913 | COMPLETED | PHASE1 | Solid Tumors Harboring NTRK Fusion | 75 | 2014-05-04 |
| NTRK3 fusion | Selitrectinib | NCT03215511 | COMPLETED | PHASE1 | Solid Tumors Harboring NTRK Fusion | 81 | 2017-07-03 |
| NTRK3 fusion | Tyrosine | NCT02122913 | COMPLETED | PHASE1 | Solid Tumors Harboring NTRK Fusion | 75 | 2014-05-04 |
| NTRK3 fusion | Tyrosine | NCT03215511 | COMPLETED | PHASE1 | Solid Tumors Harboring NTRK Fusion | 81 | 2017-07-03 |
| NTRK3 fusion | Selitrectinib | NCT03206931 | NO_LONGER_AVAILABLE | Unknown | Solid Tumors Harboring NTRK Fusion | Unknown | Unknown |
| NTRK3 fusion | Tyrosine | NCT03206931 | NO_LONGER_AVAILABLE | Unknown | Solid Tumors Harboring NTRK Fusion | Unknown | Unknown |
| NTRK3 fusion | Entrectinib | NCT02587650 | TERMINATED | PHASE2 | ALK Fusion Protein Expression, BRAF wt Allele, Invasive Skin Melanoma, MET Fusion Gene Positive, NRAS wt Allele, NTRK1 Fusion Positive, NTRK2 Fusion Positive, NTRK3 Fusion Positive, RET Fusion Positive, ROS1 Fusion Positive, Stage III Cutaneous Melanoma, Stage IIIA Cutaneous Melanoma, Stage IIIB Cutaneous Melanoma, Stage IIIC Cutaneous Melanoma, Stage IV Cutaneous Melanoma | 1 | 2015-03-26 |
| NTRK3 fusion | Tyrosine | NCT02587650 | TERMINATED | PHASE2 | ALK Fusion Protein Expression, BRAF wt Allele, Invasive Skin Melanoma, MET Fusion Gene Positive, NRAS wt Allele, NTRK1 Fusion Positive, NTRK2 Fusion Positive, NTRK3 Fusion Positive, RET Fusion Positive, ROS1 Fusion Positive, Stage III Cutaneous Melanoma, Stage IIIA Cutaneous Melanoma, Stage IIIB Cutaneous Melanoma, Stage IIIC Cutaneous Melanoma, Stage IV Cutaneous Melanoma | 1 | 2015-03-26 |
| NTRK3 fusion | Crizotinib | NCT02465060 | ACTIVE_NOT_RECRUITING | PHASE2 | Advanced Lymphoma, Advanced Malignant Solid Neoplasm, Bladder Carcinoma, Breast Carcinoma, Cervical Carcinoma, Colon Carcinoma, Colorectal Carcinoma, Endometrial Carcinoma, Esophageal Carcinoma, Exocrine Pancreas Carcinoma, Gastric Carcinoma, Glioma, Head and Neck Carcinoma, Hematopoietic and Lymphoid Cell Neoplasm, Kidney Carcinoma, Liver Carcinoma, Lung Carcinoma, Lymphoma, Malignant Uterine Corpus Neoplasm, Malignant Uterine Neoplasm, Melanoma, Multiple Myeloma, Ovarian Carcinoma, Prostate Carcinoma, Rectal Carcinoma, Recurrent Bladder Carcinoma, Recurrent Breast Carcinoma, Recurrent Cervical Carcinoma, Recurrent Colon Carcinoma, Recurrent Colorectal Carcinoma, Recurrent Esophageal Carcinoma, Recurrent Gastric Carcinoma, Recurrent Glioma, Recurrent Head and Neck Carcinoma, Recurrent Liver Carcinoma, Recurrent Lung Carcinoma, Recurrent Lymphoma, Recurrent Malignant Solid Neoplasm, Recurrent Malignant Uterine Corpus Neoplasm, Recurrent Melanoma, Recurrent Multiple Myeloma, Recurrent Ovarian Carcinoma, Recurrent Pancreatic Carcinoma, Recurrent Prostate Carcinoma, Recurrent Rectal Carcinoma, Recurrent Skin Carcinoma, Recurrent Thyroid Gland Carcinoma, Refractory Lymphoma, Refractory Malignant Solid Neoplasm, Refractory Multiple Myeloma, Skin Carcinoma, Thyroid Gland Carcinoma | 6452 | 2015-08-17 |
| NTRK3 fusion | Crizotinib | NCT02568267 | ACTIVE_NOT_RECRUITING | PHASE2 | Breast Cancer, Cholangiocarcinoma, Colorectal Cancer, Head and Neck Neoplasms, Lymphoma, Large-Cell, Anaplastic, Melanoma, Neuroendocrine Tumors, Non-Small Cell Lung Cancer, Ovarian Cancer, Pancreatic Cancer, Papillary Thyroid Cancer, Primary Brain Tumors, Renal Cell Carcinoma, Sarcomas, Salivary Gland Cancers, Adult Solid Tumor | 534 | 2015-11-19 |
| NTRK3 fusion | Entrectinib | NCT02568267 | ACTIVE_NOT_RECRUITING | PHASE2 | Breast Cancer, Cholangiocarcinoma, Colorectal Cancer, Head and Neck Neoplasms, Lymphoma, Large-Cell, Anaplastic, Melanoma, Neuroendocrine Tumors, Non-Small Cell Lung Cancer, Ovarian Cancer, Pancreatic Cancer, Papillary Thyroid Cancer, Primary Brain Tumors, Renal Cell Carcinoma, Sarcomas, Salivary Gland Cancers, Adult Solid Tumor | 534 | 2015-11-19 |
| NTRK3 fusion | Entrectinib | NCT02650401 | ACTIVE_NOT_RECRUITING | PHASE1, PHASE2 | Solid Tumors, CNS Tumors | 69 | 2016-05-03 |
| NTRK3 fusion | Entrectinib | NCT03375437 | ACTIVE_NOT_RECRUITING | NA | Soft Tissue Sarcoma, Advanced Cancer, Metastatic Cancer | 376 | 2018-02-15 |
| NTRK3 fusion | Iodine | NCT04970134 | ACTIVE_NOT_RECRUITING | Unknown | Differentiated Thyroid Carcinoma, Medullary Thyroid Carcinoma | 150 | 2021-06-14 |
| NTRK3 fusion | Larotrectinib | NCT02465060 | ACTIVE_NOT_RECRUITING | PHASE2 | Advanced Lymphoma, Advanced Malignant Solid Neoplasm, Bladder Carcinoma, Breast Carcinoma, Cervical Carcinoma, Colon Carcinoma, Colorectal Carcinoma, Endometrial Carcinoma, Esophageal Carcinoma, Exocrine Pancreas Carcinoma, Gastric Carcinoma, Glioma, Head and Neck Carcinoma, Hematopoietic and Lymphoid Cell Neoplasm, Kidney Carcinoma, Liver Carcinoma, Lung Carcinoma, Lymphoma, Malignant Uterine Corpus Neoplasm, Malignant Uterine Neoplasm, Melanoma, Multiple Myeloma, Ovarian Carcinoma, Prostate Carcinoma, Rectal Carcinoma, Recurrent Bladder Carcinoma, Recurrent Breast Carcinoma, Recurrent Cervical Carcinoma, Recurrent Colon Carcinoma, Recurrent Colorectal Carcinoma, Recurrent Esophageal Carcinoma, Recurrent Gastric Carcinoma, Recurrent Glioma, Recurrent Head and Neck Carcinoma, Recurrent Liver Carcinoma, Recurrent Lung Carcinoma, Recurrent Lymphoma, Recurrent Malignant Solid Neoplasm, Recurrent Malignant Uterine Corpus Neoplasm, Recurrent Melanoma, Recurrent Multiple Myeloma, Recurrent Ovarian Carcinoma, Recurrent Pancreatic Carcinoma, Recurrent Prostate Carcinoma, Recurrent Rectal Carcinoma, Recurrent Skin Carcinoma, Recurrent Thyroid Gland Carcinoma, Refractory Lymphoma, Refractory Malignant Solid Neoplasm, Refractory Multiple Myeloma, Skin Carcinoma, Thyroid Gland Carcinoma | 6452 | 2015-08-17 |
| NTRK3 fusion | Larotrectinib | NCT02576431 | ACTIVE_NOT_RECRUITING | PHASE2 | Solid Tumors Harboring NTRK Fusion | 215 | 2015-09-30 |
| NTRK3 fusion | Larotrectinib | NCT02637687 | ACTIVE_NOT_RECRUITING | PHASE1, PHASE2 | Solid Tumors Harboring NTRK Fusion | 154 | 2015-12-16 |
| NTRK3 fusion | Larotrectinib | NCT03155620 | ACTIVE_NOT_RECRUITING | PHASE2 | Advanced Malignant Solid Neoplasm, Ann Arbor Stage III Non-Hodgkin Lymphoma, Ann Arbor Stage IV Non-Hodgkin Lymphoma, Histiocytic Sarcoma, Juvenile Xanthogranuloma, Langerhans Cell Histiocytosis, Malignant Glioma, Recurrent Childhood Rhabdomyosarcoma, Recurrent Ependymoma, Recurrent Ewing Sarcoma, Recurrent Glioma, Recurrent Hepatoblastoma, Recurrent Langerhans Cell Histiocytosis, Recurrent Malignant Germ Cell Tumor, Recurrent Malignant Solid Neoplasm, Recurrent Medulloblastoma, Recurrent Neuroblastoma, Recurrent Non-Hodgkin Lymphoma, Recurrent Osteosarcoma, Recurrent Peripheral Primitive Neuroectodermal Tumor, Recurrent Primary Central Nervous System Neoplasm, Recurrent Rhabdoid Tumor, Recurrent Soft Tissue Sarcoma, Refractory Ewing Sarcoma, Refractory Glioma, Refractory Hepatoblastoma, Refractory Langerhans Cell Histiocytosis, Refractory Malignant Germ Cell Tumor, Refractory Malignant Solid Neoplasm, Refractory Medulloblastoma, Refractory Neuroblastoma, Refractory Non-Hodgkin Lymphoma, Refractory Osteosarcoma, Refractory Peripheral Primitive Neuroectodermal Tumor, Refractory Primary Central Nervous System Neoplasm, Refractory Rhabdoid Tumor, Refractory Rhabdomyosarcoma, Rhabdoid Tumor, Stage III Osteosarcoma AJCC v7, Stage III Soft Tissue Sarcoma AJCC v7, Stage IV Osteosarcoma AJCC v7, Stage IV Soft Tissue Sarcoma AJCC v7, Stage IVA Osteosarcoma AJCC v7, Stage IVB Osteosarcoma AJCC v7, Wilms Tumor | 2316 | 2017-07-31 |
| NTRK3 fusion | MCC | NCT02465060 | ACTIVE_NOT_RECRUITING | PHASE2 | Advanced Lymphoma, Advanced Malignant Solid Neoplasm, Bladder Carcinoma, Breast Carcinoma, Cervical Carcinoma, Colon Carcinoma, Colorectal Carcinoma, Endometrial Carcinoma, Esophageal Carcinoma, Exocrine Pancreas Carcinoma, Gastric Carcinoma, Glioma, Head and Neck Carcinoma, Hematopoietic and Lymphoid Cell Neoplasm, Kidney Carcinoma, Liver Carcinoma, Lung Carcinoma, Lymphoma, Malignant Uterine Corpus Neoplasm, Malignant Uterine Neoplasm, Melanoma, Multiple Myeloma, Ovarian Carcinoma, Prostate Carcinoma, Rectal Carcinoma, Recurrent Bladder Carcinoma, Recurrent Breast Carcinoma, Recurrent Cervical Carcinoma, Recurrent Colon Carcinoma, Recurrent Colorectal Carcinoma, Recurrent Esophageal Carcinoma, Recurrent Gastric Carcinoma, Recurrent Glioma, Recurrent Head and Neck Carcinoma, Recurrent Liver Carcinoma, Recurrent Lung Carcinoma, Recurrent Lymphoma, Recurrent Malignant Solid Neoplasm, Recurrent Malignant Uterine Corpus Neoplasm, Recurrent Melanoma, Recurrent Multiple Myeloma, Recurrent Ovarian Carcinoma, Recurrent Pancreatic Carcinoma, Recurrent Prostate Carcinoma, Recurrent Rectal Carcinoma, Recurrent Skin Carcinoma, Recurrent Thyroid Gland Carcinoma, Refractory Lymphoma, Refractory Malignant Solid Neoplasm, Refractory Multiple Myeloma, Skin Carcinoma, Thyroid Gland Carcinoma | 6452 | 2015-08-17 |
| NTRK3 fusion | Ribose | NCT03155620 | ACTIVE_NOT_RECRUITING | PHASE2 | Advanced Malignant Solid Neoplasm, Ann Arbor Stage III Non-Hodgkin Lymphoma, Ann Arbor Stage IV Non-Hodgkin Lymphoma, Histiocytic Sarcoma, Juvenile Xanthogranuloma, Langerhans Cell Histiocytosis, Malignant Glioma, Recurrent Childhood Rhabdomyosarcoma, Recurrent Ependymoma, Recurrent Ewing Sarcoma, Recurrent Glioma, Recurrent Hepatoblastoma, Recurrent Langerhans Cell Histiocytosis, Recurrent Malignant Germ Cell Tumor, Recurrent Malignant Solid Neoplasm, Recurrent Medulloblastoma, Recurrent Neuroblastoma, Recurrent Non-Hodgkin Lymphoma, Recurrent Osteosarcoma, Recurrent Peripheral Primitive Neuroectodermal Tumor, Recurrent Primary Central Nervous System Neoplasm, Recurrent Rhabdoid Tumor, Recurrent Soft Tissue Sarcoma, Refractory Ewing Sarcoma, Refractory Glioma, Refractory Hepatoblastoma, Refractory Langerhans Cell Histiocytosis, Refractory Malignant Germ Cell Tumor, Refractory Malignant Solid Neoplasm, Refractory Medulloblastoma, Refractory Neuroblastoma, Refractory Non-Hodgkin Lymphoma, Refractory Osteosarcoma, Refractory Peripheral Primitive Neuroectodermal Tumor, Refractory Primary Central Nervous System Neoplasm, Refractory Rhabdoid Tumor, Refractory Rhabdomyosarcoma, Rhabdoid Tumor, Stage III Osteosarcoma AJCC v7, Stage III Soft Tissue Sarcoma AJCC v7, Stage IV Osteosarcoma AJCC v7, Stage IV Soft Tissue Sarcoma AJCC v7, Stage IVA Osteosarcoma AJCC v7, Stage IVB Osteosarcoma AJCC v7, Wilms Tumor | 2316 | 2017-07-31 |
| NTRK3 fusion | Selpercatinib | NCT03155620 | ACTIVE_NOT_RECRUITING | PHASE2 | Advanced Malignant Solid Neoplasm, Ann Arbor Stage III Non-Hodgkin Lymphoma, Ann Arbor Stage IV Non-Hodgkin Lymphoma, Histiocytic Sarcoma, Juvenile Xanthogranuloma, Langerhans Cell Histiocytosis, Malignant Glioma, Recurrent Childhood Rhabdomyosarcoma, Recurrent Ependymoma, Recurrent Ewing Sarcoma, Recurrent Glioma, Recurrent Hepatoblastoma, Recurrent Langerhans Cell Histiocytosis, Recurrent Malignant Germ Cell Tumor, Recurrent Malignant Solid Neoplasm, Recurrent Medulloblastoma, Recurrent Neuroblastoma, Recurrent Non-Hodgkin Lymphoma, Recurrent Osteosarcoma, Recurrent Peripheral Primitive Neuroectodermal Tumor, Recurrent Primary Central Nervous System Neoplasm, Recurrent Rhabdoid Tumor, Recurrent Soft Tissue Sarcoma, Refractory Ewing Sarcoma, Refractory Glioma, Refractory Hepatoblastoma, Refractory Langerhans Cell Histiocytosis, Refractory Malignant Germ Cell Tumor, Refractory Malignant Solid Neoplasm, Refractory Medulloblastoma, Refractory Neuroblastoma, Refractory Non-Hodgkin Lymphoma, Refractory Osteosarcoma, Refractory Peripheral Primitive Neuroectodermal Tumor, Refractory Primary Central Nervous System Neoplasm, Refractory Rhabdoid Tumor, Refractory Rhabdomyosarcoma, Rhabdoid Tumor, Stage III Osteosarcoma AJCC v7, Stage III Soft Tissue Sarcoma AJCC v7, Stage IV Osteosarcoma AJCC v7, Stage IV Soft Tissue Sarcoma AJCC v7, Stage IVA Osteosarcoma AJCC v7, Stage IVB Osteosarcoma AJCC v7, Wilms Tumor | 2316 | 2017-07-31 |
| NTRK3 fusion | Trametinib | NCT02465060 | ACTIVE_NOT_RECRUITING | PHASE2 | Advanced Lymphoma, Advanced Malignant Solid Neoplasm, Bladder Carcinoma, Breast Carcinoma, Cervical Carcinoma, Colon Carcinoma, Colorectal Carcinoma, Endometrial Carcinoma, Esophageal Carcinoma, Exocrine Pancreas Carcinoma, Gastric Carcinoma, Glioma, Head and Neck Carcinoma, Hematopoietic and Lymphoid Cell Neoplasm, Kidney Carcinoma, Liver Carcinoma, Lung Carcinoma, Lymphoma, Malignant Uterine Corpus Neoplasm, Malignant Uterine Neoplasm, Melanoma, Multiple Myeloma, Ovarian Carcinoma, Prostate Carcinoma, Rectal Carcinoma, Recurrent Bladder Carcinoma, Recurrent Breast Carcinoma, Recurrent Cervical Carcinoma, Recurrent Colon Carcinoma, Recurrent Colorectal Carcinoma, Recurrent Esophageal Carcinoma, Recurrent Gastric Carcinoma, Recurrent Glioma, Recurrent Head and Neck Carcinoma, Recurrent Liver Carcinoma, Recurrent Lung Carcinoma, Recurrent Lymphoma, Recurrent Malignant Solid Neoplasm, Recurrent Malignant Uterine Corpus Neoplasm, Recurrent Melanoma, Recurrent Multiple Myeloma, Recurrent Ovarian Carcinoma, Recurrent Pancreatic Carcinoma, Recurrent Prostate Carcinoma, Recurrent Rectal Carcinoma, Recurrent Skin Carcinoma, Recurrent Thyroid Gland Carcinoma, Refractory Lymphoma, Refractory Malignant Solid Neoplasm, Refractory Multiple Myeloma, Skin Carcinoma, Thyroid Gland Carcinoma | 6452 | 2015-08-17 |
| NTRK3 fusion | Tyrosine | NCT02465060 | ACTIVE_NOT_RECRUITING | PHASE2 | Advanced Lymphoma, Advanced Malignant Solid Neoplasm, Bladder Carcinoma, Breast Carcinoma, Cervical Carcinoma, Colon Carcinoma, Colorectal Carcinoma, Endometrial Carcinoma, Esophageal Carcinoma, Exocrine Pancreas Carcinoma, Gastric Carcinoma, Glioma, Head and Neck Carcinoma, Hematopoietic and Lymphoid Cell Neoplasm, Kidney Carcinoma, Liver Carcinoma, Lung Carcinoma, Lymphoma, Malignant Uterine Corpus Neoplasm, Malignant Uterine Neoplasm, Melanoma, Multiple Myeloma, Ovarian Carcinoma, Prostate Carcinoma, Rectal Carcinoma, Recurrent Bladder Carcinoma, Recurrent Breast Carcinoma, Recurrent Cervical Carcinoma, Recurrent Colon Carcinoma, Recurrent Colorectal Carcinoma, Recurrent Esophageal Carcinoma, Recurrent Gastric Carcinoma, Recurrent Glioma, Recurrent Head and Neck Carcinoma, Recurrent Liver Carcinoma, Recurrent Lung Carcinoma, Recurrent Lymphoma, Recurrent Malignant Solid Neoplasm, Recurrent Malignant Uterine Corpus Neoplasm, Recurrent Melanoma, Recurrent Multiple Myeloma, Recurrent Ovarian Carcinoma, Recurrent Pancreatic Carcinoma, Recurrent Prostate Carcinoma, Recurrent Rectal Carcinoma, Recurrent Skin Carcinoma, Recurrent Thyroid Gland Carcinoma, Refractory Lymphoma, Refractory Malignant Solid Neoplasm, Refractory Multiple Myeloma, Skin Carcinoma, Thyroid Gland Carcinoma | 6452 | 2015-08-17 |
| NTRK3 fusion | Tyrosine | NCT02576431 | ACTIVE_NOT_RECRUITING | PHASE2 | Solid Tumors Harboring NTRK Fusion | 215 | 2015-09-30 |
| NTRK3 fusion | Tyrosine | NCT02637687 | ACTIVE_NOT_RECRUITING | PHASE1, PHASE2 | Solid Tumors Harboring NTRK Fusion | 154 | 2015-12-16 |
| NTRK3 fusion | Tyrosine | NCT02650401 | ACTIVE_NOT_RECRUITING | PHASE1, PHASE2 | Solid Tumors, CNS Tumors | 69 | 2016-05-03 |
| NTRK3 fusion | Tyrosine | NCT04557813 | ACTIVE_NOT_RECRUITING | Unknown | NTRK Family Gene Mutation | 88 | 2020-12-02 |
| NTRK3 fusion | Larotrectinib | NCT03025360 | APPROVED_FOR_MARKETING | Unknown | Tumors Harboring NTRK Fusion | Unknown | Unknown |
| NTRK3 fusion | Tyrosine | NCT03025360 | APPROVED_FOR_MARKETING | Unknown | Tumors Harboring NTRK Fusion | Unknown | Unknown |
| NTRK3 fusion | Larotrectinib | NCT02122913 | COMPLETED | PHASE1 | Solid Tumors Harboring NTRK Fusion | 75 | 2014-05-04 |
| NTRK3 fusion | Selitrectinib | NCT03215511 | COMPLETED | PHASE1 | Solid Tumors Harboring NTRK Fusion | 81 | 2017-07-03 |
| NTRK3 fusion | Tyrosine | NCT02122913 | COMPLETED | PHASE1 | Solid Tumors Harboring NTRK Fusion | 75 | 2014-05-04 |
| NTRK3 fusion | Tyrosine | NCT03215511 | COMPLETED | PHASE1 | Solid Tumors Harboring NTRK Fusion | 81 | 2017-07-03 |
| NTRK3 fusion | Selitrectinib | NCT03206931 | NO_LONGER_AVAILABLE | Unknown | Solid Tumors Harboring NTRK Fusion | Unknown | Unknown |
| NTRK3 fusion | Tyrosine | NCT03206931 | NO_LONGER_AVAILABLE | Unknown | Solid Tumors Harboring NTRK Fusion | Unknown | Unknown |
| NTRK3 fusion | Entrectinib | NCT02587650 | TERMINATED | PHASE2 | ALK Fusion Protein Expression, BRAF wt Allele, Invasive Skin Melanoma, MET Fusion Gene Positive, NRAS wt Allele, NTRK1 Fusion Positive, NTRK2 Fusion Positive, NTRK3 Fusion Positive, RET Fusion Positive, ROS1 Fusion Positive, Stage III Cutaneous Melanoma, Stage IIIA Cutaneous Melanoma, Stage IIIB Cutaneous Melanoma, Stage IIIC Cutaneous Melanoma, Stage IV Cutaneous Melanoma | 1 | 2015-03-26 |
| NTRK3 fusion | Tyrosine | NCT02587650 | TERMINATED | PHASE2 | ALK Fusion Protein Expression, BRAF wt Allele, Invasive Skin Melanoma, MET Fusion Gene Positive, NRAS wt Allele, NTRK1 Fusion Positive, NTRK2 Fusion Positive, NTRK3 Fusion Positive, RET Fusion Positive, ROS1 Fusion Positive, Stage III Cutaneous Melanoma, Stage IIIA Cutaneous Melanoma, Stage IIIB Cutaneous Melanoma, Stage IIIC Cutaneous Melanoma, Stage IV Cutaneous Melanoma | 1 | 2015-03-26 |
Fusion-Positive Patients' Treatment Records |
| Fusion-Positive Patients' Treatment Records in TCGA cohorts |
| Fusion Gene | Drugs |
| ETV6-NTRK3 | Cyclophosphamide, Fluorouracil, Methotrexate |
| Pediatric Sarcoma Fusion-Positive Patients' Treatment Records in the Clinical Data Warehouse (CDW) in UTHealth. |
| Fusion Gene | ICD-10 | Disease Name | Treatments |
| ETV6-NTRK3 | C96.20 | Congenital fibrosarcoma | |
| ETV6-NTRK3 | D41.0 | Congenital mesoblastic nephroma |
Generative AI Summary Sentence of the Relationship Between Fusion Gene and Small Molecule that Have at Least Thrree PMIDs from PubMed |
| Generative AI summary sentence of the relationship between fusion gene and small molecule that have at least thrree PMIDs from PubMed using the ChatGPT 4 |
| Found PMIDs | Fusion Gene | Drugs | One Sentence Summary |
| # pmid >1 | ETV6-NTRK3 | Cabozantinib | ETV6-NTRK3 and Cabozantinib: Cabozantinib is effective against ETV6-NTRK3 positive cancers. |
| # pmid >4 | ETV6-NTRK3 | Crizotinib | ETV6-NTRK3 and Crizotinib: Crizotinib, originally developed as an ALK inhibitor, also shows activity against cancers with ETV6-NTRK3 fusions. |
| # pmid >2 | ETV6-NTRK3 | Cyclophosphamide | ETV6-NTRK3 and Cyclophosphamide: Cyclophosphamide is used in chemotherapy regimens for cancers with ETV6-NTRK3 fusions, but it is not a targeted therapy. |
| # pmid >4 | ETV6-NTRK3 | Entrectinib | ETV6-NTRK3 and Entrectinib: Entrectinib is a potent inhibitor of TRK proteins and shows efficacy in treating cancers with ETV6-NTRK3 fusions. |
| # pmid >2 | ETV6-NTRK3 | Iodine | ETV6-NTRK3 and Iodine: There is limited scientific literature specifically discussing the relationship between ETV6-NTRK3 and iodine. |
| # pmid >4 | ETV6-NTRK3 | Larotrectinib | ETV6-NTRK3 and Larotrectinib: Larotrectinib is a selective TRK inhibitor used to treat solid tumors with NTRK gene fusions, including those with the ETV6-NTRK3 fusion, demonstrating significant efficacy across various cancer types. |
| # pmid >2 | ETV6-NTRK3 | Progesterone | ETV6-NTRK3 and Progesterone: The relationship between ETV6-NTRK3 and progesterone is not well-documented in scientific literature. |
| # pmid >2 | ETV6-NTRK3 | Repotrectinib | ETV6-NTRK3 and Repotrectinib: Repotrectinib has shown efficacy in preclinical studies for treating cancers with ETV6-NTRK3 fusions. |
| # pmid >2 | ETV6-NTRK3 | Selitrectinib | ETV6-NTRK3 and Selitrectinib: Selitrectinib is a TRK inhibitor that has demonstrated activity against cancers with ETV6-NTRK3 fusions. |
| # pmid >1 | ETV6-NTRK3 | Staurosporine | ETV6-NTRK3 and Staurosporine: Staurosporine reduces the viability of ETV6-NTRK3 positive cells by inhibiting cell growth and inducing apoptosis. |
| # pmid >4 | ETV6-NTRK3 | Tyrosine | ETV6-NTRK3 and Tyrosine: Tyrosine kinase inhibitors targeting TRK proteins are effective against cancers harboring ETV6-NTRK3 fusions. |
| # pmid >4 | ETV6-NTRK3 | Vincristine | ETV6-NTRK3 and Vincristine: Vincristine is a chemotherapy agent used in various cancer treatments, but it is not specifically targeted for ETV6-NTRK3 fusions. |
Copyright 2024-PresentThe University of Texas Health Science Center at Houston (UTHealth Houston) Web File Viewing | Emergency Information |